The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methyl-1-(2-(5-methyl-2-((4-morpholinophenyl)amino)pyrimidin-4-yl)-6,7-dihydrofuro[3,2-c]pyridin-5(4H)-yl)propan-1-one ID: ALA4524537
PubChem CID: 72202825
Max Phase: Preclinical
Molecular Formula: C26H31N5O3
Molecular Weight: 461.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1-c1cc2c(o1)CCN(C(=O)C(C)C)C2
Standard InChI: InChI=1S/C26H31N5O3/c1-17(2)25(32)31-9-8-22-19(16-31)14-23(34-22)24-18(3)15-27-26(29-24)28-20-4-6-21(7-5-20)30-10-12-33-13-11-30/h4-7,14-15,17H,8-13,16H2,1-3H3,(H,27,28,29)
Standard InChI Key: PVKVZMYRWLFHQT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
34.6770 -11.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6770 -12.2826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3864 -12.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3864 -11.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0958 -11.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0957 -12.2791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8737 -12.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3562 -11.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8738 -11.2058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1745 -11.8671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5825 -12.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4030 -12.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8166 -11.8686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3995 -11.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5803 -11.1575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.8097 -10.4411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.6310 -10.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0378 -11.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8584 -11.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2694 -10.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8498 -9.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0306 -9.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1732 -13.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0873 -10.4310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.4981 -11.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3159 -11.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7290 -10.4286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.3140 -9.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4901 -9.7214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9699 -12.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2574 -12.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9710 -13.5136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2562 -11.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5462 -12.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
11 23 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
20 24 1 0
2 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.57Molecular Weight (Monoisotopic): 461.2427AlogP: 4.17#Rotatable Bonds: 5Polar Surface Area: 83.73Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.30CX LogP: 3.81CX LogD: 3.81Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -1.41
References 1. Wang Y, Huang W, Xin M, Chen P, Gui L, Zhao X, Zhu X, Luo H, Cong X, Wang J, Liu F.. (2019) Discovery of potent anti-inflammatory 4-(4,5,6,7-tetrahydrofuro[3,2-c]pyridin-2-yl) pyrimidin-2-amines for use as Janus kinase inhibitors., 27 (12): [PMID:30926315 ] [10.1016/j.bmc.2019.03.048 ]