Benzyl ((S)-1-Oxo-3-phenyl-1-(((S,E)-5-phenyl-1-(pyrimidin-2-yl)pent-1-en-3-yl)amino)propan-2-yl)carbamate

ID: ALA4524680

PubChem CID: 155538690

Max Phase: Preclinical

Molecular Formula: C32H32N4O3

Molecular Weight: 520.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(N[C@@H](Cc1ccccc1)C(=O)N[C@H](/C=C/c1ncccn1)CCc1ccccc1)OCc1ccccc1

Standard InChI:  InChI=1S/C32H32N4O3/c37-31(35-28(18-17-25-11-4-1-5-12-25)19-20-30-33-21-10-22-34-30)29(23-26-13-6-2-7-14-26)36-32(38)39-24-27-15-8-3-9-16-27/h1-16,19-22,28-29H,17-18,23-24H2,(H,35,37)(H,36,38)/b20-19+/t28-,29-/m0/s1

Standard InChI Key:  GXOCDWNIEOAISL-IGFRKTAPSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   10.9619   -6.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5942   -7.4283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3003   -7.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0096   -7.4230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2973   -6.1999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7157   -7.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4250   -7.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1312   -7.0064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4281   -8.2348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8404   -7.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5466   -7.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8435   -8.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5527   -8.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2558   -7.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7127   -6.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4188   -5.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1257   -6.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8313   -5.7829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8287   -4.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1145   -4.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4117   -4.9720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864   -7.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1812   -7.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4719   -7.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7672   -7.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7718   -8.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4870   -8.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1888   -8.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5507   -9.4524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6707   -7.4044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3764   -6.9938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3737   -6.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6594   -5.7701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9567   -6.1830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8407   -9.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8383  -10.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5454  -11.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2564  -10.6727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2552   -9.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 10 12  1  6
 12 13  1  0
 11 14  2  0
 14  1  1  0
  6 15  1  1
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  2 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 13 29  1  0
  1 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34  1  1  0
 29 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4524680

    ---

Associated Targets(non-human)

Cruzipain (33337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.63Molecular Weight (Monoisotopic): 520.2474AlogP: 5.15#Rotatable Bonds: 12
Polar Surface Area: 93.21Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.29CX Basic pKa: 1.89CX LogP: 6.30CX LogD: 6.30
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.27Np Likeness Score: -0.16

References

1. Chenna BC, Li L, Mellott DM, Zhai X, Siqueira-Neto JL, Calvet Alvarez C, Bernatchez JA, Desormeaux E, Alvarez Hernandez E, Gomez J, McKerrow JH, Cruz-Reyes J, Meek TD..  (2020)  Peptidomimetic Vinyl Heterocyclic Inhibitors of Cruzain Effect Antitrypanosomal Activity.,  63  (6): [PMID:32125159] [10.1021/acs.jmedchem.9b02078]

Source