2-(4-((4-(3-methoxypyridin-2-yl)piperidin-1-yl)methyl)piperidin-1-yl)pyrazine

ID: ALA4524686

PubChem CID: 155538474

Max Phase: Preclinical

Molecular Formula: C21H29N5O

Molecular Weight: 367.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccnc1C1CCN(CC2CCN(c3cnccn3)CC2)CC1

Standard InChI:  InChI=1S/C21H29N5O/c1-27-19-3-2-8-24-21(19)18-6-11-25(12-7-18)16-17-4-13-26(14-5-17)20-15-22-9-10-23-20/h2-3,8-10,15,17-18H,4-7,11-14,16H2,1H3

Standard InChI Key:  ZYYIGGBRIFVPNW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   12.7407   -4.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5602   -4.2825    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9672   -3.5739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5598   -2.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7371   -2.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3298   -3.5757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7896   -3.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2009   -4.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0187   -4.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4313   -3.5743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0241   -2.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2002   -2.8567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9673   -2.1512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7886   -2.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2526   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6625   -4.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2421   -5.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6485   -5.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4701   -5.7200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8837   -5.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4799   -4.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8729   -6.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4570   -7.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8594   -7.8533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6816   -7.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0997   -7.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6908   -6.4390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  3  7  1  0
  4 13  1  0
 13 14  1  0
 10 15  1  0
 15 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 19 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4524686

    ---

Associated Targets(Human)

CHRM4 Tclin Muscarinic acetylcholine receptor M4 (6041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CHRM2 Tclin Muscarinic acetylcholine receptor M2 (10671 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 367.50Molecular Weight (Monoisotopic): 367.2372AlogP: 2.98#Rotatable Bonds: 5
Polar Surface Area: 54.38Molecular Species: BASEHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.48CX LogP: 1.75CX LogD: -0.31
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.81Np Likeness Score: -1.49

References

1. Yang Q, Lachapelle EA, Kablaoui NM, Webb D, Popiolek M, Grimwood S, Kozak R, O'Connor RE, Lazzaro JT, Butler CR, Zhang L..  (2019)  Discovery of Selective M4 Muscarinic Acetylcholine Receptor Agonists with Novel Carbamate Isosteres.,  10  (6): [PMID:31223452] [10.1021/acsmedchemlett.9b00106]

Source