((6S,7aR)-6-Allyl-7a-((R)-1-(2,5-difluoro-4-methoxyphenyl)-propan-2-yl)-7,7a-dihydrobenzo[d][1,3]dioxol-5(6H)-one)

ID: ALA4524729

PubChem CID: 126508929

Max Phase: Preclinical

Molecular Formula: C20H22F2O4

Molecular Weight: 364.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC[C@H]1C[C@]2([C@H](C)Cc3cc(F)c(OC)cc3F)OCOC2=CC1=O

Standard InChI:  InChI=1S/C20H22F2O4/c1-4-5-13-10-20(19(9-17(13)23)25-11-26-20)12(2)6-14-7-16(22)18(24-3)8-15(14)21/h4,7-9,12-13H,1,5-6,10-11H2,2-3H3/t12-,13+,20-/m1/s1

Standard InChI Key:  HBZILKFBVZHWIS-MTJIALIYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   35.5223  -10.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5223  -10.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2341  -11.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9501  -10.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2341   -9.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9489  -10.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5561   -9.5011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2242   -8.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4044   -8.8351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2341  -12.1182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8076  -11.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0870  -10.8868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3723  -11.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5138   -9.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5095   -8.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8005   -9.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0785   -9.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0787   -8.4054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3664   -7.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6474   -8.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6558   -9.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3732   -9.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9327   -8.0011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3786  -10.4694    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.2221   -8.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3664   -7.1715    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  5  1  1  6
  2  3  1  0
  3  4  1  0
  4  6  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  5  9  1  0
  3 10  2  0
  2 11  1  1
 11 12  1  0
 12 13  2  0
 14  5  1  0
 14 15  1  1
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 22 24  1  0
 23 25  1  0
 19 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4524729

    ---

Associated Targets(Human)

M14 (47487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H460 (60772 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.39Molecular Weight (Monoisotopic): 364.1486AlogP: 3.94#Rotatable Bonds: 6
Polar Surface Area: 44.76Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.28CX LogD: 4.28
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.72Np Likeness Score: 0.80

References

1. Huang Z, Williams RB, Martin SM, Lawrence JA, Norman VL, O'Neil-Johnson M, Harding J, Mangette JE, Liu S, Guzzo PR, Starks CM, Eldridge GR..  (2018)  Bifidenone: Structure-Activity Relationship and Advanced Preclinical Candidate.,  61  (15): [PMID:29995409] [10.1021/acs.jmedchem.7b01644]

Source