2-(3,4-dimethoxyphenyl)-5-(2-(piperidin-1-yl)-5-(trifluoromethoxy)phenyl)-1,3,4-oxadiazole

ID: ALA4524757

PubChem CID: 155538549

Max Phase: Preclinical

Molecular Formula: C22H22F3N3O4

Molecular Weight: 449.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nnc(-c3cc(OC(F)(F)F)ccc3N3CCCCC3)o2)cc1OC

Standard InChI:  InChI=1S/C22H22F3N3O4/c1-29-18-9-6-14(12-19(18)30-2)20-26-27-21(31-20)16-13-15(32-22(23,24)25)7-8-17(16)28-10-4-3-5-11-28/h6-9,12-13H,3-5,10-11H2,1-2H3

Standard InChI Key:  BYSXYFYNCUJKEV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   25.0715  -27.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0704  -28.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7784  -28.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4881  -28.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4852  -27.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7766  -27.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7742  -26.4924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4807  -26.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4782  -25.2645    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.1896  -26.4882    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.1861  -25.6672    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.7782  -29.7641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1964  -28.9450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2836  -29.7551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0832  -29.9238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.4908  -29.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9429  -28.6091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3075  -29.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7164  -29.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5324  -29.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9391  -29.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5238  -28.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7093  -28.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7562  -29.2050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1682  -29.9107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9274  -27.7902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7446  -27.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0691  -30.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0670  -30.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7728  -31.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4824  -30.9854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4862  -30.1656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  3 12  1  0
  4 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  1  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 22 26  1  0
 26 27  1  0
 12 28  1  0
 12 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4524757

    ---

Associated Targets(non-human)

Grm7 Metabotropic glutamate receptor 7 (580 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.43Molecular Weight (Monoisotopic): 449.1562AlogP: 5.31#Rotatable Bonds: 6
Polar Surface Area: 69.85Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.50CX LogP: 5.08CX LogD: 5.08
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -0.92

References

1. Reed CW, Washecheck JP, Quitlag MC, Jenkins MT, Rodriguez AL, Engers DW, Blobaum AL, Conn PJ, Niswender CM, Lindsley CW..  (2019)  Surveying heterocycles as amide bioisosteres within a series of mGlu7 NAMs: Discovery of VU6019278.,  29  (10): [PMID:30910459] [10.1016/j.bmcl.2019.03.016]

Source