The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3,4-dimethoxyphenyl)-5-(2-(piperidin-1-yl)-5-(trifluoromethoxy)phenyl)-1,3,4-oxadiazole ID: ALA4524757
PubChem CID: 155538549
Max Phase: Preclinical
Molecular Formula: C22H22F3N3O4
Molecular Weight: 449.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nnc(-c3cc(OC(F)(F)F)ccc3N3CCCCC3)o2)cc1OC
Standard InChI: InChI=1S/C22H22F3N3O4/c1-29-18-9-6-14(12-19(18)30-2)20-26-27-21(31-20)16-13-15(32-22(23,24)25)7-8-17(16)28-10-4-3-5-11-28/h6-9,12-13H,3-5,10-11H2,1-2H3
Standard InChI Key: BYSXYFYNCUJKEV-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
25.0715 -27.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0704 -28.5380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7784 -28.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4881 -28.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4852 -27.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7766 -27.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7742 -26.4924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4807 -26.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4782 -25.2645 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.1896 -26.4882 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.1861 -25.6672 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.7782 -29.7641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1964 -28.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2836 -29.7551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0832 -29.9238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4908 -29.2154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9429 -28.6091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3075 -29.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7164 -29.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5324 -29.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9391 -29.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5238 -28.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7093 -28.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7562 -29.2050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1682 -29.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9274 -27.7902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7446 -27.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0691 -30.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0670 -30.9800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7728 -31.3926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4824 -30.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4862 -30.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
3 12 1 0
4 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
22 26 1 0
26 27 1 0
12 28 1 0
12 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.43Molecular Weight (Monoisotopic): 449.1562AlogP: 5.31#Rotatable Bonds: 6Polar Surface Area: 69.85Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.50CX LogP: 5.08CX LogD: 5.08Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -0.92
References 1. Reed CW, Washecheck JP, Quitlag MC, Jenkins MT, Rodriguez AL, Engers DW, Blobaum AL, Conn PJ, Niswender CM, Lindsley CW.. (2019) Surveying heterocycles as amide bioisosteres within a series of mGlu7 NAMs: Discovery of VU6019278., 29 (10): [PMID:30910459 ] [10.1016/j.bmcl.2019.03.016 ]