(E)-N-(3-(1H-Imidazol-1-yl)propyl)-2-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)acryl-amide

ID: ALA4524814

PubChem CID: 155538708

Max Phase: Preclinical

Molecular Formula: C24H27N3O4

Molecular Weight: 421.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=C(/C(=O)NCCCn2ccnc2)c2ccc(OC)c(OC)c2)cc1

Standard InChI:  InChI=1S/C24H27N3O4/c1-29-20-8-5-18(6-9-20)15-21(19-7-10-22(30-2)23(16-19)31-3)24(28)26-11-4-13-27-14-12-25-17-27/h5-10,12,14-17H,4,11,13H2,1-3H3,(H,26,28)/b21-15+

Standard InChI Key:  WRAHRFAQQITJEE-RCCKNPSSSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    5.1343   -5.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8420   -5.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5497   -5.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8420   -4.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1343   -4.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4270   -5.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7198   -5.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7194   -6.5100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4320   -6.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1363   -6.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1370   -3.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4302   -2.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7215   -3.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7241   -4.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4315   -4.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0132   -2.8354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0121   -2.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0122   -6.9196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3039   -6.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4349   -7.7357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7287   -8.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2574   -5.2870    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5497   -6.5128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9651   -5.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6728   -5.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3805   -5.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0882   -5.2870    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8353   -5.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3821   -5.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9735   -4.2996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1742   -4.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  4  5  1  0
  1  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  1  1  0
  5 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  5  1  0
 13 16  1  0
 16 17  1  0
  8 18  1  0
 18 19  1  0
  9 20  1  0
 20 21  1  0
  3 22  1  0
  3 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4524814

    ---

Associated Targets(Human)

Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mahlavu (271 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.50Molecular Weight (Monoisotopic): 421.2002AlogP: 3.66#Rotatable Bonds: 10
Polar Surface Area: 74.61Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.79CX LogP: 2.71CX LogD: 2.65
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -0.81

References

1. Güzelcan EA, Baxendale IR, Cetin-Atalay R, Baumann M..  (2019)  Synthesis of new derivatives of boehmeriasin A and their biological evaluation in liver cancer.,  166  [PMID:30716712] [10.1016/j.ejmech.2019.01.056]

Source