The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(3-(1H-Imidazol-1-yl)propyl)-2-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)acryl-amide ID: ALA4524814
PubChem CID: 155538708
Max Phase: Preclinical
Molecular Formula: C24H27N3O4
Molecular Weight: 421.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C(/C(=O)NCCCn2ccnc2)c2ccc(OC)c(OC)c2)cc1
Standard InChI: InChI=1S/C24H27N3O4/c1-29-20-8-5-18(6-9-20)15-21(19-7-10-22(30-2)23(16-19)31-3)24(28)26-11-4-13-27-14-12-25-17-27/h5-10,12,14-17H,4,11,13H2,1-3H3,(H,26,28)/b21-15+
Standard InChI Key: WRAHRFAQQITJEE-RCCKNPSSSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
5.1343 -5.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8420 -5.2870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5497 -5.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8420 -4.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1343 -4.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4270 -5.2841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7198 -5.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7194 -6.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4320 -6.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1363 -6.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1370 -3.2429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4302 -2.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7215 -3.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7241 -4.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4315 -4.4693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0132 -2.8354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0121 -2.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0122 -6.9196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3039 -6.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4349 -7.7357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7287 -8.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2574 -5.2870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5497 -6.5128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9651 -5.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6728 -5.2870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3805 -5.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0882 -5.2870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8353 -5.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3821 -5.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9735 -4.2996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1742 -4.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
4 5 1 0
1 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 1 1 0
5 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 5 1 0
13 16 1 0
16 17 1 0
8 18 1 0
18 19 1 0
9 20 1 0
20 21 1 0
3 22 1 0
3 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.50Molecular Weight (Monoisotopic): 421.2002AlogP: 3.66#Rotatable Bonds: 10Polar Surface Area: 74.61Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.79CX LogP: 2.71CX LogD: 2.65Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -0.81
References 1. Güzelcan EA, Baxendale IR, Cetin-Atalay R, Baumann M.. (2019) Synthesis of new derivatives of boehmeriasin A and their biological evaluation in liver cancer., 166 [PMID:30716712 ] [10.1016/j.ejmech.2019.01.056 ]