The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-ethyl-5-((cis)-4-hydroxy-4-methylcyclohexylamino)-3-(3-methyl-4-(4-(4-methylpiperazin-1-yl)piperidin-1-yl)phenylamino)pyrazine-2-carboxamide hemifumaric acid ID: ALA4524842
Max Phase: Preclinical
Molecular Formula: C35H52N8O6
Molecular Weight: 564.78
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc(C(N)=O)c(Nc2ccc(N3CCC(N4CCN(C)CC4)CC3)c(C)c2)nc1N[C@H]1CC[C@@](C)(O)CC1.O=C(O)/C=C/C(=O)O
Standard InChI: InChI=1S/C31H48N8O2.C4H4O4/c1-5-25-29(33-22-8-12-31(3,41)13-9-22)36-30(27(35-25)28(32)40)34-23-6-7-26(21(2)20-23)39-14-10-24(11-15-39)38-18-16-37(4)17-19-38;5-3(6)1-2-4(7)8/h6-7,20,22,24,41H,5,8-19H2,1-4H3,(H2,32,40)(H2,33,34,36);1-2H,(H,5,6)(H,7,8)/b;2-1+/t22-,31+;
Standard InChI Key: CFWAEFQSQDLLPB-BAZCKRPDSA-N
Molfile:
RDKit 2D
49 52 0 0 0 0 0 0 0 0999 V2000
20.8912 -10.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6057 -9.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3201 -10.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0346 -9.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3201 -10.8872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1768 -9.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4624 -10.0624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1768 -8.8249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4037 -3.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4000 -8.0278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1129 -3.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8277 -3.0665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5427 -3.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5427 -4.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8302 -4.7189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1129 -4.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3981 -4.7211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3981 -5.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1128 -5.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6856 -6.7890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6789 -5.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2575 -4.7200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9723 -4.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9723 -3.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6913 -3.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4062 -4.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6913 -4.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2575 -3.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3981 -3.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6832 -3.4818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3981 -2.2387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1117 -6.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3999 -7.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6868 -8.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6850 -9.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3974 -9.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1131 -9.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1166 -8.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3944 -10.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2549 -2.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1181 -3.0665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8268 -7.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6782 -10.9030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6733 -11.7244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3844 -12.1433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1022 -11.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1088 -10.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3784 -12.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1163 -3.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
3 5 2 0
1 6 1 0
6 7 1 0
6 8 2 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
16 17 1 0
17 18 1 0
19 18 2 0
32 19 1 0
20 33 1 0
21 20 2 0
18 21 1 0
14 22 1 0
23 22 1 1
24 23 1 0
25 24 1 0
9 25 1 0
26 9 1 0
27 26 1 0
23 27 1 0
13 28 1 0
11 29 1 0
29 30 2 0
29 31 1 0
32 33 2 0
33 10 1 0
10 34 1 0
10 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
36 39 1 0
28 40 1 0
9 41 1 1
32 42 1 0
39 43 1 0
39 47 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
45 48 1 0
9 49 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 564.78Molecular Weight (Monoisotopic): 564.3900AlogP: 3.51#Rotatable Bonds: 8Polar Surface Area: 122.88Molecular Species: BASEHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.52CX LogP: 4.20CX LogD: 2.99Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.38Np Likeness Score: -0.80
References 1. (2016) Diamino heterocyclic carboxamide compound,