The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(3,5-dimethoxybenzyl)piperazin-1-yl)-N-(4-phenylthiazol-2-yl)propanamide ID: ALA4524875
PubChem CID: 155538783
Max Phase: Preclinical
Molecular Formula: C25H30N4O3S
Molecular Weight: 466.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CN2CCN(CCC(=O)Nc3nc(-c4ccccc4)cs3)CC2)cc(OC)c1
Standard InChI: InChI=1S/C25H30N4O3S/c1-31-21-14-19(15-22(16-21)32-2)17-29-12-10-28(11-13-29)9-8-24(30)27-25-26-23(18-33-25)20-6-4-3-5-7-20/h3-7,14-16,18H,8-13,17H2,1-2H3,(H,26,27,30)
Standard InChI Key: JADMELACBDELCI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
23.7970 -14.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6220 -14.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0344 -13.7910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6220 -13.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7970 -13.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3843 -13.7910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8594 -13.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2708 -13.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0952 -13.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5107 -12.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0970 -11.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2677 -11.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8601 -12.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5593 -13.7922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1457 -14.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3207 -14.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9113 -15.2245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9093 -13.7944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0862 -15.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5993 -14.5629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8148 -14.8177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8159 -15.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6011 -15.8952 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.1465 -14.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2367 -13.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5686 -13.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8140 -13.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7315 -14.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3965 -14.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8558 -10.9374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2647 -10.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3357 -12.3682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7474 -11.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
3 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
6 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 24 1 0
12 30 1 0
30 31 1 0
10 32 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.61Molecular Weight (Monoisotopic): 466.2039AlogP: 3.97#Rotatable Bonds: 9Polar Surface Area: 66.93Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.05CX Basic pKa: 7.23CX LogP: 3.58CX LogD: 3.60Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.72
References 1. Chen L, Chen H, Chen P, Zhang W, Wu C, Sun C, Luo W, Zheng L, Liu Z, Liang G.. (2019) Development of 2-amino-4-phenylthiazole analogues to disrupt myeloid differentiation factor 88 and prevent inflammatory responses in acute lung injury., 161 [PMID:30342423 ] [10.1016/j.ejmech.2018.09.068 ]