3-(4-(3,5-dimethoxybenzyl)piperazin-1-yl)-N-(4-phenylthiazol-2-yl)propanamide

ID: ALA4524875

PubChem CID: 155538783

Max Phase: Preclinical

Molecular Formula: C25H30N4O3S

Molecular Weight: 466.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CN2CCN(CCC(=O)Nc3nc(-c4ccccc4)cs3)CC2)cc(OC)c1

Standard InChI:  InChI=1S/C25H30N4O3S/c1-31-21-14-19(15-22(16-21)32-2)17-29-12-10-28(11-13-29)9-8-24(30)27-25-26-23(18-33-25)20-6-4-3-5-7-20/h3-7,14-16,18H,8-13,17H2,1-2H3,(H,26,27,30)

Standard InChI Key:  JADMELACBDELCI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   23.7970  -14.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6220  -14.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0344  -13.7910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6220  -13.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7970  -13.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3843  -13.7910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8594  -13.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2708  -13.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0952  -13.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5107  -12.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0970  -11.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2677  -11.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8601  -12.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5593  -13.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1457  -14.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3207  -14.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9113  -15.2245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9093  -13.7944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0862  -15.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5993  -14.5629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8148  -14.8177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8159  -15.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6011  -15.8952    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.1465  -14.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2367  -13.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5686  -13.0331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8140  -13.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7315  -14.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3965  -14.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8558  -10.9374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2647  -10.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3357  -12.3682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7474  -11.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  3  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  6 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 21 24  1  0
 12 30  1  0
 30 31  1  0
 10 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4524875

    ---

Associated Targets(non-human)

Peritoneal macrophage (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.61Molecular Weight (Monoisotopic): 466.2039AlogP: 3.97#Rotatable Bonds: 9
Polar Surface Area: 66.93Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.05CX Basic pKa: 7.23CX LogP: 3.58CX LogD: 3.60
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.72

References

1. Chen L, Chen H, Chen P, Zhang W, Wu C, Sun C, Luo W, Zheng L, Liu Z, Liang G..  (2019)  Development of 2-amino-4-phenylthiazole analogues to disrupt myeloid differentiation factor 88 and prevent inflammatory responses in acute lung injury.,  161  [PMID:30342423] [10.1016/j.ejmech.2018.09.068]

Source