The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-methoxy-N2,N3-bis[4-(pentafluoro-lambda6-sulfanyl)phenyl]quinoxaline-2,3-diamine ID: ALA4524916
PubChem CID: 155538768
Max Phase: Preclinical
Molecular Formula: C21H16F10N4OS2
Molecular Weight: 594.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nc(Nc3ccc(S(F)(F)(F)(F)F)cc3)c(Nc3ccc(S(F)(F)(F)(F)F)cc3)nc2c1
Standard InChI: InChI=1S/C21H16F10N4OS2/c1-36-15-6-11-18-19(12-15)35-21(33-14-4-9-17(10-5-14)38(27,28,29,30)31)20(34-18)32-13-2-7-16(8-3-13)37(22,23,24,25)26/h2-12H,1H3,(H,32,34)(H,33,35)
Standard InChI Key: PBEUAXSAHSFBMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
26.8107 -13.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6680 -13.0516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2383 -11.3911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0970 -11.8103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8089 -11.3975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2359 -13.0481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0958 -12.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6713 -11.3979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9558 -11.8087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5242 -11.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5230 -12.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9546 -12.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6733 -10.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3833 -10.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3856 -9.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6784 -8.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9673 -9.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9685 -10.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3892 -11.4018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6792 -8.1345 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.6657 -13.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9561 -14.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9534 -15.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6605 -15.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3718 -15.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3709 -14.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6593 -16.3186 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.3874 -7.7267 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.9720 -7.7251 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.6748 -7.3134 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.3847 -8.5392 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.9690 -8.5351 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.9510 -16.7262 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.3664 -16.7283 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.6541 -17.1321 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.2361 -15.7330 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.9484 -15.9063 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.6816 -11.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 8 1 0
6 12 2 0
12 9 1 0
10 11 1 0
12 2 1 0
10 5 2 0
7 1 1 0
5 4 1 0
1 11 2 0
11 6 1 0
9 3 2 0
4 7 2 0
10 3 1 0
8 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
4 19 1 0
16 20 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
20 28 1 0
20 29 1 0
20 30 1 0
20 31 1 0
20 32 1 0
27 33 1 0
27 34 1 0
27 35 1 0
27 36 1 0
27 37 1 0
19 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 594.50Molecular Weight (Monoisotopic): 594.0606AlogP: 10.44#Rotatable Bonds: 7Polar Surface Area: 59.07Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.71CX Basic pKa: 1.76CX LogP: 8.64CX LogD: 8.64Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: -0.58
References 1. (2017) Aryl amine substituted quinoxaline used as anticancer drugs,