The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Phenyl-4-(4-(2-((5,6,7,8-tetrahydronaphthalen-1-yl)oxy)ethyl)benzyl)piperazine dihydrochloride ID: ALA4525002
PubChem CID: 155538797
Max Phase: Preclinical
Molecular Formula: C29H36Cl2N2O
Molecular Weight: 426.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.c1ccc(N2CCN(Cc3ccc(CCOc4cccc5c4CCCC5)cc3)CC2)cc1
Standard InChI: InChI=1S/C29H34N2O.2ClH/c1-2-9-27(10-3-1)31-20-18-30(19-21-31)23-25-15-13-24(14-16-25)17-22-32-29-12-6-8-26-7-4-5-11-28(26)29;;/h1-3,6,8-10,12-16H,4-5,7,11,17-23H2;2*1H
Standard InChI Key: KBUALHJUNQCFMO-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
26.2403 -4.1534 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.5748 -2.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3999 -2.9611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8137 -2.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3994 -1.5367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5712 -1.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1652 -2.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8113 -3.6803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3930 -4.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8045 -5.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6317 -5.1162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0458 -4.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6368 -3.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0398 -5.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8667 -5.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2760 -6.5594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1021 -6.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5175 -5.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1050 -5.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2803 -5.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3443 -5.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7576 -6.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5845 -6.5714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9935 -7.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5761 -7.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9845 -8.7156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8122 -8.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8149 -7.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2240 -7.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0400 -8.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4530 -7.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0482 -6.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2261 -6.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4159 -3.6876 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
3 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 29 1 0
28 24 1 0
28 29 2 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.60Molecular Weight (Monoisotopic): 426.2671AlogP: 5.51#Rotatable Bonds: 7Polar Surface Area: 15.71Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.04CX LogP: 6.96CX LogD: 6.23Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -0.97
References 1. Chen H, Yu YZ, Tian XM, Wang CL, Qian YN, Deng ZA, Zhang JX, Lv DJ, Zhang HB, Shen JL, Yuan M, Zhao SC.. (2019) Synthesis and biological evaluation of arylpiperazine derivatives as potential anti-prostate cancer agents., 27 (1): [PMID:30482547 ] [10.1016/j.bmc.2018.11.029 ]