The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-bromophenyl)(2-(2-(3-(4-methoxyphenyl)-1-phenyl-1H-pyrazol-4-yl)vinyl)-7H-furo[2,3-f]chromen-3-yl)methanone ID: ALA4525005
PubChem CID: 155538803
Max Phase: Preclinical
Molecular Formula: C36H25BrN2O4
Molecular Weight: 629.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nn(-c3ccccc3)cc2/C=C/c2oc3c4c(ccc3c2C(=O)c2ccc(Br)cc2)OCC=C4)cc1
Standard InChI: InChI=1S/C36H25BrN2O4/c1-41-28-16-11-23(12-17-28)34-25(22-39(38-34)27-6-3-2-4-7-27)13-19-32-33(35(40)24-9-14-26(37)15-10-24)30-18-20-31-29(36(30)43-32)8-5-21-42-31/h2-20,22H,21H2,1H3/b19-13+
Standard InChI Key: VIDRMSLWKIKVJV-CPNJWEJPSA-N
Molfile:
RDKit 2D
43 49 0 0 0 0 0 0 0 0999 V2000
9.0702 -3.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7795 -2.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4922 -3.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4970 -4.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2812 -4.4519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7627 -3.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2734 -3.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5840 -3.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9967 -4.4872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8180 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5214 -2.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3238 -2.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9710 -1.7322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7813 -4.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0762 -4.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3692 -4.6156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3651 -5.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0701 -5.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7833 -5.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8749 -2.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6767 -2.5961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9253 -1.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3702 -1.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5705 -1.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3065 -5.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0863 -4.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0815 -4.0661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2987 -3.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7390 -3.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4921 -3.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1500 -3.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0600 -2.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3025 -2.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6478 -2.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7276 -1.6369 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
14.0587 -5.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2550 -6.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0030 -6.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5579 -7.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3638 -7.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6080 -6.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3111 -8.2724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5089 -8.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 15 2 0
14 4 2 0
3 2 2 0
2 1 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 3 1 0
6 8 1 0
8 9 2 0
9 10 1 0
7 11 1 0
11 12 1 0
11 13 2 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
12 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 12 1 0
10 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 10 2 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
27 29 1 0
22 35 1 0
25 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
39 42 1 0
42 43 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 629.51Molecular Weight (Monoisotopic): 628.0998AlogP: 8.86#Rotatable Bonds: 7Polar Surface Area: 66.49Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.37CX LogP: 8.79CX LogD: 8.79Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.17Np Likeness Score: -0.22
References 1. Xu Z, Zhao S, Lv Z, Feng L, Wang Y, Zhang F, Bai L, Deng J.. (2019) Benzofuran derivatives and their anti-tubercular, anti-bacterial activities., 162 [PMID:30448416 ] [10.1016/j.ejmech.2018.11.025 ]