The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
diethyl(2-(2-((5-fluoro-4-(4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole-6-yl)pyrimidin-2-yl)amino)-7,8-dihydro-1,6-naphthyridin-6(5H)-yl)ethyl)(methyl)phosphoramidate ID: ALA4525034
PubChem CID: 130196784
Max Phase: Preclinical
Molecular Formula: C30H39F2N8O3P
Molecular Weight: 628.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)N(C)CCN1CCc2nc(Nc3ncc(F)c(-c4cc(F)c5nc(C)n(C(C)C)c5c4)n3)ccc2C1
Standard InChI: InChI=1S/C30H39F2N8O3P/c1-7-42-44(41,43-8-2)38(6)13-14-39-12-11-25-21(18-39)9-10-27(35-25)36-30-33-17-24(32)28(37-30)22-15-23(31)29-26(16-22)40(19(3)4)20(5)34-29/h9-10,15-17,19H,7-8,11-14,18H2,1-6H3,(H,33,35,36,37)
Standard InChI Key: SAIXTBXXQWMWMW-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
17.1486 -19.7075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7442 -19.0018 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
16.3352 -19.7049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9423 -20.1945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9412 -21.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6492 -21.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6475 -19.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2366 -19.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2377 -18.9679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5308 -18.5596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8222 -18.9684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8250 -19.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5326 -20.1945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1188 -20.2011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4096 -19.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4080 -18.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6996 -18.5720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7072 -20.2069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9982 -19.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9940 -18.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2866 -18.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5788 -18.9930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5830 -19.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2950 -20.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3561 -20.1909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3609 -21.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1409 -21.2580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6183 -20.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1331 -19.9334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4354 -20.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6503 -22.2402 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.8696 -18.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1634 -18.9982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4542 -18.5923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4512 -17.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9458 -18.5599 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.3811 -19.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1794 -18.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8307 -18.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0388 -18.5975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7415 -20.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3307 -21.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9658 -19.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3722 -20.4191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 26 2 0
25 7 2 0
7 4 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 8 1 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 20 2 0
19 18 2 0
18 15 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 1 0
28 30 1 0
6 31 1 0
22 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
9 36 1 0
29 37 1 0
37 38 1 0
37 39 1 0
34 2 1 0
2 40 2 0
3 41 1 0
41 42 1 0
1 43 1 0
43 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.67Molecular Weight (Monoisotopic): 628.2851AlogP: 6.27#Rotatable Bonds: 12Polar Surface Area: 110.53Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.37CX Basic pKa: 6.75CX LogP: 4.43CX LogD: 4.34Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.18Np Likeness Score: -1.20
References 1. Shi C, Wang Q, Liao X, Ge H, Huo G, Zhang L, Chen N, Zhai X, Hong Y, Wang L, Han Y, Xiao W, Wang Z, Shi W, Mao Y, Yu J, Xia G, Liu Y.. (2019) Discovery of 6-(2-(dimethylamino)ethyl)-N-(5-fluoro-4-(4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole-6-yl)pyrimidin-2-yl)-5,6,7,8-tetrahydro-1,6-naphthyridin-2-amine as a highly potent cyclin-dependent kinase 4/6 inhibitor for treatment of cancer., 178 [PMID:31200237 ] [10.1016/j.ejmech.2019.06.005 ]