Ethyl (4R,4aS,6aR,9S,11aR,11bS,E)-8-(((1,3-dioxolan-2-yl)methoxy)imino)-4,9,11b-trimethyltetradecahydro-6a,9-methanocyclohepta[a]naphthalene-4-carboxylate

ID: ALA4525061

PubChem CID: 155538805

Max Phase: Preclinical

Molecular Formula: C26H41NO5

Molecular Weight: 447.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)C/C4=N\OCC1OCCO1

Standard InChI:  InChI=1S/C26H41NO5/c1-5-29-22(28)25(4)10-6-9-24(3)18(25)8-12-26-15-20(23(2,17-26)11-7-19(24)26)27-32-16-21-30-13-14-31-21/h18-19,21H,5-17H2,1-4H3/b27-20+/t18-,19-,23-,24+,25+,26-/m0/s1

Standard InChI Key:  IEXSZLJRHMJSOG-YKTFEVBJSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   16.9007  -12.7659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5045  -12.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1037  -12.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3031  -12.7607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9005  -13.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0998  -13.4521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5018  -13.4599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8193  -11.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8193  -10.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5081  -10.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2010  -10.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1975  -11.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8872  -12.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5807  -11.6864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5842  -10.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8900  -10.4801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8954   -9.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6011   -9.2798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2953   -9.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2838  -10.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9837  -10.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2738  -11.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7741   -9.8797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3491  -10.4604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1395  -10.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7144  -10.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5790  -11.6358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3053  -12.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8860  -11.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5185  -10.7055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8599   -9.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8871  -11.2801    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.1896  -12.4770    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.1937  -10.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  6
  3  4  1  0
  4  5  1  0
  5  6  1  0
  3  7  2  0
  8  2  1  0
  9  8  1  0
  9 10  1  0
 11 10  1  0
 11 12  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 11 16  1  0
 16 17  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 15 20  1  0
 19 21  1  0
 22 21  1  0
 15 22  1  6
 21 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
 19 31  1  1
 16 32  1  1
 12 33  1  1
 11 34  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4525061

    ---

Associated Targets(Human)

F10 Tclin Coagulation factor X (9693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.62Molecular Weight (Monoisotopic): 447.2985AlogP: 5.10#Rotatable Bonds: 5
Polar Surface Area: 66.35Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.90CX LogP: 5.45CX LogD: 5.45
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: 1.77

References

1. Chen P, Zhang D, Li M, Wu Q, Lam YPY, Guo Y, Chen C, Bai N, Malhotra S, Li W, O'Connor PB, Fu H..  (2019)  Discovery of novel, potent, isosteviol-based antithrombotic agents.,  183  [PMID:31563807] [10.1016/j.ejmech.2019.111722]

Source