N-((2S,3R)-3-hydroxy-4-(N-isobutyl-4-methoxyphenylsulfonamido)-1-phenylbutan-2-yl)-2-(9H-purin-9-yl)acetamide

ID: ALA4525077

PubChem CID: 146000386

Max Phase: Preclinical

Molecular Formula: C28H34N6O5S

Molecular Weight: 566.68

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)Cn2cnc3cncnc32)cc1

Standard InChI:  InChI=1S/C28H34N6O5S/c1-20(2)15-34(40(37,38)23-11-9-22(39-3)10-12-23)16-26(35)24(13-21-7-5-4-6-8-21)32-27(36)17-33-19-31-25-14-29-18-30-28(25)33/h4-12,14,18-20,24,26,35H,13,15-17H2,1-3H3,(H,32,36)/t24-,26+/m0/s1

Standard InChI Key:  XAWZWCCXPPUERX-AZGAKELHSA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   10.4295  -19.0141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8422  -19.7240    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.2506  -19.0117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1816  -19.7282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8893  -20.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5970  -19.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3047  -20.1367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5970  -18.9110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0125  -19.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7202  -20.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4279  -19.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1356  -20.1367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5510  -20.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5494  -20.9550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2562  -21.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9649  -20.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9623  -20.1335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2548  -19.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7202  -20.9539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0125  -18.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7202  -18.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4278  -18.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1350  -18.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1354  -17.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4227  -17.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7184  -17.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1376  -20.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0919  -18.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2926  -18.7482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4308  -20.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8874  -19.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0915  -19.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8380  -20.3975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3865  -21.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1803  -20.8342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7143  -21.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5315  -21.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4025  -22.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6732  -21.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6743  -22.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  2  1  0
  2 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 10 19  1  1
  9 20  1  1
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 12 27  1  0
  4 28  1  0
 28 29  2  0
 29 31  1  0
 30  4  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 27 36  1  0
 36 37  1  0
 36 38  1  0
 16 39  1  0
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4525077

    ---

Associated Targets(non-human)

protease Protease (2551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 566.68Molecular Weight (Monoisotopic): 566.2311AlogP: 2.27#Rotatable Bonds: 13
Polar Surface Area: 139.54Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.09CX Basic pKa: 2.21CX LogP: 2.21CX LogD: 2.21
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.91

References

1. Zhu M, Dong B, Zhang GN, Wang JX, Cen S, Wang YC..  (2019)  Synthesis and biological evaluation of new HIV-1 protease inhibitors with purine bases as P2-ligands.,  29  (12): [PMID:31014912] [10.1016/j.bmcl.2019.03.049]

Source