The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((9-(3-hydroxypropyl)-6-((4-(morpholinomethyl)phenyl)amino)-9H-purin-2-yl)amino)butan-1-ol ID: ALA4525165
PubChem CID: 155512081
Max Phase: Preclinical
Molecular Formula: C23H33N7O3
Molecular Weight: 455.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: OCCCCNc1nc(Nc2ccc(CN3CCOCC3)cc2)c2ncn(CCCO)c2n1
Standard InChI: InChI=1S/C23H33N7O3/c31-12-2-1-8-24-23-27-21(20-22(28-23)30(17-25-20)9-3-13-32)26-19-6-4-18(5-7-19)16-29-10-14-33-15-11-29/h4-7,17,31-32H,1-3,8-16H2,(H2,24,26,27,28)
Standard InChI Key: JFBMYNINNITHEP-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
19.0899 -29.8828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0888 -30.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8036 -31.1231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8019 -29.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5172 -29.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5174 -30.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3036 -30.9608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7891 -30.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3032 -29.6237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3741 -31.1222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7993 -28.6452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5126 -28.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2261 -28.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9389 -28.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9368 -27.4035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2161 -26.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5063 -27.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2956 -31.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0060 -32.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7244 -31.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4348 -32.2162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6496 -26.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3658 -27.3974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3634 -28.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0756 -28.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7907 -28.2185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7891 -27.3926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0724 -26.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6599 -30.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9452 -31.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2310 -30.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5162 -31.1199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8021 -30.7068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
2 10 1 0
4 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
7 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
15 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
10 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.56Molecular Weight (Monoisotopic): 455.2645AlogP: 1.97#Rotatable Bonds: 12Polar Surface Area: 120.59Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.98CX LogP: 1.09CX LogD: 0.95Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: -1.37
References 1. Řezníčková E, Gucký T, Kováčová V, Ajani H, Jorda R, Kryštof V.. (2019) Activity of 2,6,9-trisubstituted purines as potent PDGFRα kinase inhibitors with antileukaemic activity., 182 [PMID:31514019 ] [10.1016/j.ejmech.2019.111663 ]