N-[(1S)-1-Benzyl-2-[(3-fluoro-2-oxo-propyl)amino]-2-oxo-ethyl]quinoline-8-carboxamide

ID: ALA4525169

PubChem CID: 155519459

Max Phase: Preclinical

Molecular Formula: C22H20FN3O3

Molecular Weight: 393.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CF)CNC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccc2cccnc12

Standard InChI:  InChI=1S/C22H20FN3O3/c23-13-17(27)14-25-22(29)19(12-15-6-2-1-3-7-15)26-21(28)18-10-4-8-16-9-5-11-24-20(16)18/h1-11,19H,12-14H2,(H,25,29)(H,26,28)/t19-/m0/s1

Standard InChI Key:  JBOWXQXSWZMTBF-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   24.9120  -13.0338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6197  -12.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3274  -13.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0351  -12.6252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3274  -13.8510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6197  -11.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3274  -11.3994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7428  -13.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4505  -12.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1582  -13.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4505  -11.8080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8659  -12.6252    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.2042  -12.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2042  -11.8080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0347  -11.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7420  -11.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7424  -10.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0297  -10.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3254  -10.5866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4974  -13.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0817  -13.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7944  -14.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4987  -13.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0822  -13.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7876  -12.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7884  -11.8129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0844  -11.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3782  -11.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3809  -12.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  2  6  1  1
  6  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
  1 13  1  0
 13 14  2  0
  7 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19  7  1  0
 20 25  2  0
 24 21  2  0
 21 22  1  0
 22 23  2  0
 23 20  1  0
 13 20  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4525169

    ---

Associated Targets(Human)

ATG4B Tchem Cysteine protease ATG4B (985 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 393.42Molecular Weight (Monoisotopic): 393.1489AlogP: 2.23#Rotatable Bonds: 8
Polar Surface Area: 88.16Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.86CX Basic pKa: 2.99CX LogP: 2.21CX LogD: 2.21
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -0.72

References

1. Qiu Z, Kuhn B, Aebi J, Lin X, Ding H, Zhou Z, Xu Z, Xu D, Han L, Liu C, Qiu H, Zhang Y, Haap W, Riemer C, Stahl M, Qin N, Shen HC, Tang G..  (2016)  Discovery of Fluoromethylketone-Based Peptidomimetics as Covalent ATG4B (Autophagin-1) Inhibitors.,  (8): [PMID:27563406] [10.1021/acsmedchemlett.6b00208]

Source