2-((5-(3-(aminomethyl)phenyl)-4-phenethyl-4H-1,2,4-triazol-3-yl)thio)-N-cyclopentylacetamide hydrochloride

ID: ALA4525192

PubChem CID: 155519538

Max Phase: Preclinical

Molecular Formula: C24H30ClN5OS

Molecular Weight: 435.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cl.NCc1ccc(-c2nnc(SCC(=O)NC3CCCC3)n2CCc2ccccc2)cc1

Standard InChI:  InChI=1S/C24H29N5OS.ClH/c25-16-19-10-12-20(13-11-19)23-27-28-24(29(23)15-14-18-6-2-1-3-7-18)31-17-22(30)26-21-8-4-5-9-21;/h1-3,6-7,10-13,21H,4-5,8-9,14-17,25H2,(H,26,30);1H

Standard InChI Key:  WBPBURURVSYBAR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   11.1964   -1.9152    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.0490   -3.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8569   -3.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1960   -4.0578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0160   -3.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1829   -3.1586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4660   -2.7505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7879   -4.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2047   -5.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7965   -6.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9739   -6.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5659   -6.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9827   -7.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8120   -7.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2163   -6.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5717   -4.5766    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.3776   -4.4003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9332   -5.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7392   -4.8340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6828   -5.7963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2948   -5.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1309   -6.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8477   -6.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4577   -6.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1176   -5.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7906   -2.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9835   -2.1905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4341   -2.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6974   -3.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5040   -3.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6259   -2.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3653   -1.8585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  3  2  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  5 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 21  1  0
  2 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30  2  1  0
 28 31  1  0
 31 32  1  0
M  END

Associated Targets(Human)

RAD51 Tchem DNA repair protein RAD51 homolog 1 (504 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.60Molecular Weight (Monoisotopic): 435.2093AlogP: 3.80#Rotatable Bonds: 9
Polar Surface Area: 85.83Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.19CX LogP: 3.53CX LogD: 1.75
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: -1.84

References

1. Roberti M, Schipani F, Bagnolini G, Milano D, Giacomini E, Falchi F, Balboni A, Manerba M, Farabegoli F, De Franco F, Robertson J, Minucci S, Pallavicini I, Di Stefano G, Girotto S, Pellicciari R, Cavalli A..  (2019)  Rad51/BRCA2 disruptors inhibit homologous recombination and synergize with olaparib in pancreatic cancer cells.,  165  [PMID:30660828] [10.1016/j.ejmech.2019.01.008]

Source