1'-((4-Bromo-2-ethylphenyl)sulfonyl)-4-methyl-1,4'-bipiperidine

ID: ALA4525195

PubChem CID: 118308402

Max Phase: Preclinical

Molecular Formula: C19H29BrN2O2S

Molecular Weight: 429.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1cc(Br)ccc1S(=O)(=O)N1CCC(N2CCC(C)CC2)CC1

Standard InChI:  InChI=1S/C19H29BrN2O2S/c1-3-16-14-17(20)4-5-19(16)25(23,24)22-12-8-18(9-13-22)21-10-6-15(2)7-11-21/h4-5,14-15,18H,3,6-13H2,1-2H3

Standard InChI Key:  IVFQQAMOHSJPEE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   15.1758  -20.1367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8857  -20.5453    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.8846  -19.7263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9328  -19.8561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1156  -19.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7057  -20.5537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1085  -21.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9257  -21.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3401  -20.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1529  -20.5635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5577  -21.2745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3713  -21.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7863  -20.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3815  -19.8641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5618  -19.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4754  -21.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6596  -21.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2466  -21.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6506  -22.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4721  -22.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8814  -21.9565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6035  -20.5812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6986  -21.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1064  -22.6656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2384  -23.3642    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  9 10  1  0
  6  2  1  0
  2 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 22  1  0
 21 23  1  0
 23 24  1  0
 19 25  1  0
M  END

Associated Targets(Human)

DLD-1 (17511 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.42Molecular Weight (Monoisotopic): 428.1133AlogP: 3.90#Rotatable Bonds: 4
Polar Surface Area: 40.62Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.89CX LogP: 3.92CX LogD: 2.41
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.73Np Likeness Score: -1.55

References

1. Wang W, Zhang L, Morlock L, Williams NS, Shay JW, De Brabander JK..  (2019)  Design and Synthesis of TASIN Analogues Specifically Targeting Colorectal Cancer Cell Lines with Mutant Adenomatous Polyposis Coli (APC).,  62  (10): [PMID:31070915] [10.1021/acs.jmedchem.9b00532]

Source