The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(2-oxo-1-(3-(trifluoromethyl)phenyl)-1,2-dihydrobenzo[h][1,6]naphthyridin-9-yl)pyridine-2-yl)propionamide ID: ALA4525212
PubChem CID: 155249545
Max Phase: Preclinical
Molecular Formula: C27H19F3N4O2
Molecular Weight: 488.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1ccc(-c2ccc3ncc4ccc(=O)n(-c5cccc(C(F)(F)F)c5)c4c3c2)cn1
Standard InChI: InChI=1S/C27H19F3N4O2/c1-2-24(35)33-23-10-7-17(14-32-23)16-6-9-22-21(12-16)26-18(15-31-22)8-11-25(36)34(26)20-5-3-4-19(13-20)27(28,29)30/h3-15H,2H2,1H3,(H,32,33,35)
Standard InChI Key: OSCKRJSVFBISNB-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
6.7095 -27.1860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7083 -28.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4164 -28.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4146 -26.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1232 -27.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1239 -28.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8325 -28.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5407 -27.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0037 -26.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0049 -25.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2979 -25.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5893 -25.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5921 -26.7814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2997 -27.1860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1111 -25.5460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1103 -24.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4011 -24.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6948 -24.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7021 -25.5599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4118 -25.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3969 -23.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1025 -23.0964 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.6871 -23.1038 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.3919 -22.6874 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.8222 -26.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5326 -27.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2357 -26.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2346 -25.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5243 -25.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8150 -25.9519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5217 -24.7233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8810 -25.5525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1739 -25.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4655 -25.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7662 -25.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1752 -26.7793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 26 1 0
25 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
1 9 1 0
30 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
17 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
25 26 2 0
25 30 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
29 31 2 0
12 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 36 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.47Molecular Weight (Monoisotopic): 488.1460AlogP: 5.97#Rotatable Bonds: 4Polar Surface Area: 76.88Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.12CX Basic pKa: 3.82CX LogP: 5.12CX LogD: 5.12Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: -1.43
References 1. Hao T, Li Y, Fan S, Li W, Wang S, Li S, Cao R, Zhong W.. (2019) Design, synthesis and pharmacological evaluation of a novel mTOR-targeted anti-EV71 agent., 175 [PMID:31082764 ] [10.1016/j.ejmech.2019.04.048 ]