N-(3-amino-1H-indazol-5-yl)-2,3-dichlorobenzamide

ID: ALA4525213

PubChem CID: 155519594

Max Phase: Preclinical

Molecular Formula: C14H10Cl2N4O

Molecular Weight: 321.17

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1n[nH]c2ccc(NC(=O)c3cccc(Cl)c3Cl)cc12

Standard InChI:  InChI=1S/C14H10Cl2N4O/c15-10-3-1-2-8(12(10)16)14(21)18-7-4-5-11-9(6-7)13(17)20-19-11/h1-6H,(H,18,21)(H3,17,19,20)

Standard InChI Key:  GFXUFZUGARXRDI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
    1.5009   -1.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4997   -2.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2078   -3.0692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9175   -2.6598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9146   -1.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2060   -1.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6258   -3.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6271   -3.8844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3329   -2.6575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0412   -3.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0379   -3.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7454   -4.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7414   -2.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4495   -3.0569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4565   -3.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2371   -4.1217    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7126   -3.4554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2258   -2.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4717   -2.0181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7917   -3.0683    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.2076   -3.8864    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 15  2  0
 14 13  2  0
 13 10  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 18 19  1  0
  2 20  1  0
  3 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4525213

    ---

Associated Targets(Human)

JAK1 Tclin Tyrosine-protein kinase JAK1 (8569 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
JAK2 Tclin Tyrosine-protein kinase JAK2 (12915 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 321.17Molecular Weight (Monoisotopic): 320.0232AlogP: 3.70#Rotatable Bonds: 2
Polar Surface Area: 83.80Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.49CX LogP: 3.36CX LogD: 3.36
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.67Np Likeness Score: -1.84

References

1. Egyed A, Bajusz D, Keserű GM..  (2019)  The impact of binding site waters on the activity/selectivity trade-off of Janus kinase 2 (JAK2) inhibitors.,  27  (8): [PMID:30833158] [10.1016/j.bmc.2019.02.029]

Source