2-(4-Ethoxyphenyl)-9-hexyl-8-oxo-8,9-dihydro-7H-purine-6-carboxamide

ID: ALA4525215

PubChem CID: 130298952

Max Phase: Preclinical

Molecular Formula: C20H25N5O3

Molecular Weight: 383.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCn1c(=O)[nH]c2c(C(N)=O)nc(-c3ccc(OCC)cc3)nc21

Standard InChI:  InChI=1S/C20H25N5O3/c1-3-5-6-7-12-25-19-16(23-20(25)27)15(17(21)26)22-18(24-19)13-8-10-14(11-9-13)28-4-2/h8-11H,3-7,12H2,1-2H3,(H2,21,26)(H,23,27)

Standard InChI Key:  MXYBLTGAEMGHCV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   27.0537   -5.5992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7634   -5.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7605   -4.3671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0519   -3.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3457   -5.1902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3469   -4.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5664   -4.1142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0827   -4.7778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5644   -5.4427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0501   -3.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7569   -2.7345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3415   -2.7376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2655   -4.7766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3138   -6.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4682   -5.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4682   -6.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1757   -6.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8837   -6.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8798   -5.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1717   -5.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5145   -6.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2622   -7.1623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4630   -7.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9160   -6.7253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1167   -6.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5926   -6.8190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5950   -7.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3039   -8.0427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  4 10  1  0
 10 11  1  0
 10 12  2  0
  8 13  2  0
  9 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  2 15  1  0
 14 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 18 26  1  0
 26 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4525215

    ---

Associated Targets(Human)

NCI-H1975 (4994 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.45Molecular Weight (Monoisotopic): 383.1957AlogP: 2.86#Rotatable Bonds: 9
Polar Surface Area: 115.89Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.26CX Basic pKa: CX LogP: 4.67CX LogD: 4.67
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.55Np Likeness Score: -1.36

References

1. Huang MR, Hsu YL, Lin TC, Cheng TJ, Li LW, Tseng YW, Chou YS, Liu JH, Pan SH, Fang JM, Wong CH..  (2019)  Structure-guided development of purine amide, hydroxamate, and amidoxime for the inhibition of non-small cell lung cancer.,  181  [PMID:31376567] [10.1016/j.ejmech.2019.07.054]

Source