The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Ethyl-3-(4-hydroxyphenyl)-2-{[2-(4-nitrophenyl)-1H-indol-3-ylmethylene]hydrazono}thiazolidin-4-one ID: ALA4525222
PubChem CID: 155519649
Max Phase: Preclinical
Molecular Formula: C26H21N5O4S
Molecular Weight: 499.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC1S/C(=N\N=C\c2c(-c3ccc([N+](=O)[O-])cc3)[nH]c3ccccc23)N(c2ccc(O)cc2)C1=O
Standard InChI: InChI=1S/C26H21N5O4S/c1-2-23-25(33)30(17-11-13-19(32)14-12-17)26(36-23)29-27-15-21-20-5-3-4-6-22(20)28-24(21)16-7-9-18(10-8-16)31(34)35/h3-15,23,28,32H,2H2,1H3/b27-15+,29-26-
Standard InChI Key: MSUPQAHIOHJGFI-FQVPYNAUSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
26.3713 -14.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1971 -14.5141 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.4542 -13.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7842 -13.2420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1186 -13.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2399 -13.4751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8529 -14.0285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6385 -13.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2514 -14.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4686 -14.8711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0566 -14.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9151 -15.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1626 -15.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4960 -15.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5806 -16.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3377 -16.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0011 -16.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3919 -13.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2145 -13.3168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5503 -12.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0646 -11.8942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2394 -11.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9074 -12.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3331 -13.4744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7830 -12.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4991 -12.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4982 -11.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7820 -10.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0650 -11.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0694 -12.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7795 -9.9395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8850 -15.1815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0639 -15.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4016 -11.1358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9153 -10.4684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2228 -11.0483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
3 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 13 1 0
12 10 1 0
10 11 1 0
11 9 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
11 18 1 0
5 24 2 0
4 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
1 32 1 0
32 33 1 0
34 35 2 0
34 36 1 0
21 34 1 0
M CHG 2 34 1 36 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.55Molecular Weight (Monoisotopic): 499.1314AlogP: 5.70#Rotatable Bonds: 6Polar Surface Area: 124.19Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.66CX Basic pKa: ┄CX LogP: 5.75CX LogD: 5.73Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.20Np Likeness Score: -0.90
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]