(E)-3-(4-(5-Amino-3-((4-sulfamoylphenyl)amino)-1H-1,2,4-triazole-1-carboxamido)phenyl)acrylic Acid

ID: ALA4525245

PubChem CID: 155538703

Max Phase: Preclinical

Molecular Formula: C18H17N7O5S

Molecular Weight: 443.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(Nc2ccc(S(N)(=O)=O)cc2)nn1C(=O)Nc1ccc(/C=C/C(=O)O)cc1

Standard InChI:  InChI=1S/C18H17N7O5S/c19-16-23-17(21-12-6-8-14(9-7-12)31(20,29)30)24-25(16)18(28)22-13-4-1-11(2-5-13)3-10-15(26)27/h1-10H,(H,22,28)(H,26,27)(H2,20,29,30)(H3,19,21,23,24)/b10-3+

Standard InChI Key:  YWVAPKXATJOMEM-XCVCLJGOSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   15.1469  -16.5089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9394  -16.7235    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.7290  -15.9300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1114  -14.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4038  -14.6520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6601  -14.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1134  -14.9288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5222  -15.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3214  -15.4663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4898  -13.5221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1900  -16.3831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3774  -16.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8981  -15.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0862  -15.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7533  -16.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2384  -17.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0487  -17.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6095  -17.4734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1112  -13.4260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8192  -14.6516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5268  -14.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2342  -14.6547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9413  -14.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9415  -13.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2288  -13.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5245  -13.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6486  -13.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3570  -13.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0640  -13.0166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7724  -13.4241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0627  -12.1994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  6 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15  2  1  0
  2 18  1  0
  4 19  2  0
  4 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4525245

    ---

Associated Targets(Human)

JAK2 Tclin Tyrosine-protein kinase JAK2 (12915 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.45Molecular Weight (Monoisotopic): 443.1012AlogP: 1.43#Rotatable Bonds: 6
Polar Surface Area: 195.32Molecular Species: ACIDHBA: 9HBD: 5
#RO5 Violations: HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.63CX Basic pKa: CX LogP: 2.21CX LogD: -1.13
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: -1.13

References

1. Liosi ME, Krimmer SG, Newton AS, Dawson TK, Puleo DE, Cutrona KJ, Suzuki Y, Schlessinger J, Jorgensen WL..  (2020)  Selective Janus Kinase 2 (JAK2) Pseudokinase Ligands with a Diaminotriazole Core.,  63  (10): [PMID:32329617] [10.1021/acs.jmedchem.0c00192]

Source