The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3-aminoprop-1-ynyl)-2-cyclohexyl-N-(1-isopropylpiperidin-4-yl)-6-methoxyquinazolin-4-amine ID: ALA4525421
PubChem CID: 155543202
Max Phase: Preclinical
Molecular Formula: C26H37N5O
Molecular Weight: 435.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(NC3CCN(C(C)C)CC3)nc(C3CCCCC3)nc2cc1C#CCN
Standard InChI: InChI=1S/C26H37N5O/c1-18(2)31-14-11-21(12-15-31)28-26-22-17-24(32-3)20(10-7-13-27)16-23(22)29-25(30-26)19-8-5-4-6-9-19/h16-19,21H,4-6,8-9,11-15,27H2,1-3H3,(H,28,29,30)
Standard InChI Key: FEQYZGXPHHNDPQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
17.1183 -4.2510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1172 -5.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8252 -5.4795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8234 -3.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5321 -4.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5328 -5.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2414 -5.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9496 -5.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9449 -4.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2358 -3.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8210 -3.0250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1121 -2.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1122 -1.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4074 -1.3914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6985 -1.7986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6990 -2.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4083 -3.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9911 -1.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6501 -3.8276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6451 -3.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4127 -5.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7055 -5.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9995 -5.4695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9947 -6.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7019 -6.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4140 -6.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9917 -0.5723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2831 -1.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6589 -5.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3684 -5.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0799 -6.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0875 -7.0884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
4 11 1 0
11 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
15 18 1 0
9 19 1 0
19 20 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
2 21 1 0
18 27 1 0
18 28 1 0
8 29 1 0
29 30 3 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.62Molecular Weight (Monoisotopic): 435.2998AlogP: 4.28#Rotatable Bonds: 5Polar Surface Area: 76.30Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.37CX LogP: 4.22CX LogD: 1.19Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.68Np Likeness Score: -0.77
References 1. Leenders R, Zijlmans R, van Bree B, van de Sande M, Trivarelli F, Damen E, Wegert A, Müller D, Ehlert JE, Feger D, Heidemann-Dinger C, Kubbutat M, Schächtele C, Lenstra DC, Mecinović J, Müller G.. (2019) Novel SAR for quinazoline inhibitors of EHMT1 and EHMT2., 29 (17): [PMID:31350126 ] [10.1016/j.bmcl.2019.06.012 ]