4-chloro-N-(1-ethyl-4-(morpholin-4-yl)-2-oxo-1,2-dihydroquinolin-6-yl)-N-methylbenzamide

ID: ALA4525442

PubChem CID: 134537442

Max Phase: Preclinical

Molecular Formula: C23H24ClN3O3

Molecular Weight: 425.92

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1c(=O)cc(N2CCOCC2)c2cc(N(C)C(=O)c3ccc(Cl)cc3)ccc21

Standard InChI:  InChI=1S/C23H24ClN3O3/c1-3-27-20-9-8-18(25(2)23(29)16-4-6-17(24)7-5-16)14-19(20)21(15-22(27)28)26-10-12-30-13-11-26/h4-9,14-15H,3,10-13H2,1-2H3

Standard InChI Key:  ASIQMDBHBVVXQH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   16.1861  -11.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1861  -10.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1660   -9.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1660   -8.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1861   -7.8166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1653   -8.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1653   -9.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1861   -6.6733    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.1653  -11.8588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1660  -11.8588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1660  -13.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1868  -11.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1667  -11.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1875  -11.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1674  -11.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1882  -11.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1882  -10.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1674   -9.5723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1875  -10.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1667   -9.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1868  -10.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1674   -8.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1882   -7.8166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1681   -9.5723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1674  -13.0429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1882  -13.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1882  -14.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1674  -15.3294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1875  -14.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1875  -13.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  5  8  1  0
  1  9  2  0
  1 10  1  0
 10 11  1  0
 10 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  1  0
 18 19  1  0
 14 19  2  0
 20 19  1  0
 21 20  2  0
 12 21  1  0
 18 22  1  0
 22 23  1  0
 17 24  2  0
 15 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4525442

    ---

Associated Targets(Human)

HUVEC (11049 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.92Molecular Weight (Monoisotopic): 425.1506AlogP: 3.79#Rotatable Bonds: 4
Polar Surface Area: 54.78Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.54CX LogP: 2.58CX LogD: 2.58
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: -1.74

References

1.  (2018)  Nitrogen-containing heterocyclic compound, 

Source