5-(2-(Aminomethyl)benzo[b]thiophen-6-yl)-N-phenylpicolinamide

ID: ALA4525480

PubChem CID: 134340380

Max Phase: Preclinical

Molecular Formula: C21H17N3OS

Molecular Weight: 359.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCc1cc2ccc(-c3ccc(C(=O)Nc4ccccc4)nc3)cc2s1

Standard InChI:  InChI=1S/C21H17N3OS/c22-12-18-10-15-7-6-14(11-20(15)26-18)16-8-9-19(23-13-16)21(25)24-17-4-2-1-3-5-17/h1-11,13H,12,22H2,(H,24,25)

Standard InChI Key:  OMIKJKNVZDVCKS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   23.2504   -9.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6671   -9.9423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4254   -9.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9547   -9.8881    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.1546   -9.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4379  -10.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7214   -9.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7214   -8.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4379   -8.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1546   -8.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9547   -8.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0062  -10.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2973   -9.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5826  -10.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5809  -10.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2998  -11.2830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0114  -10.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8665  -11.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1543  -10.8636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8589  -12.1068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4366  -11.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7290  -10.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0117  -11.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0047  -12.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7209  -12.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4351  -12.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  4  3  1  0
  4  5  1  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 10  5  2  0
 11 10  1  0
  3 11  2  0
  7 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4525480

    ---

Associated Targets(Human)

LOXL2 Tchem Lysyl oxidase homolog 2 (834 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 359.45Molecular Weight (Monoisotopic): 359.1092AlogP: 4.67#Rotatable Bonds: 4
Polar Surface Area: 68.01Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.57CX LogP: 4.01CX LogD: 2.82
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.56Np Likeness Score: -1.37

References

1.  (2018)  Lysyl oxidase-like 2 inhibitors and uses thereof, 

Source