The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pyridin-3-ylmethyl 4-(4-((5-chloro-4-((2-(methylcarbamoyl)phenyl)amino)pyrimidin-2-yl)amino)benzoyl)piperazine-1-carbodithioate ID: ALA4525498
PubChem CID: 155543157
Max Phase: Preclinical
Molecular Formula: C30H29ClN8O2S2
Molecular Weight: 633.20
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1ccccc1Nc1nc(Nc2ccc(C(=O)N3CCN(C(=S)SCc4cccnc4)CC3)cc2)ncc1Cl
Standard InChI: InChI=1S/C30H29ClN8O2S2/c1-32-27(40)23-6-2-3-7-25(23)36-26-24(31)18-34-29(37-26)35-22-10-8-21(9-11-22)28(41)38-13-15-39(16-14-38)30(42)43-19-20-5-4-12-33-17-20/h2-12,17-18H,13-16,19H2,1H3,(H,32,40)(H2,34,35,36,37)
Standard InChI Key: ZNEWWRLRHOQSJO-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
36.1407 -20.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1396 -21.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8476 -21.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5573 -21.2571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5545 -20.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8458 -20.0291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2606 -20.0231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.9699 -20.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4329 -20.0296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7253 -20.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0176 -20.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3105 -20.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3102 -21.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0230 -21.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7272 -21.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9696 -21.2439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6780 -21.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3852 -21.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3794 -20.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6705 -20.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0949 -21.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0991 -22.4606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.8006 -21.2312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5072 -21.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2107 -21.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2108 -20.4156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5011 -20.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7915 -20.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0184 -19.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7265 -18.8030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3110 -18.8017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3118 -17.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4315 -21.6656 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
43.9180 -20.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6262 -20.4138 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.9169 -19.1889 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
45.3334 -20.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0416 -20.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0376 -21.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7450 -21.6350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
47.4531 -21.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.4494 -20.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7414 -20.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 8 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
11 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
2 33 1 0
26 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 633.20Molecular Weight (Monoisotopic): 632.1543AlogP: 5.35#Rotatable Bonds: 8Polar Surface Area: 115.38Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.47CX Basic pKa: 4.85CX LogP: 6.22CX LogD: 6.22Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.22Np Likeness Score: -1.73
References 1. Su Y, Li R, Ning X, Lin Z, Zhao X, Zhou J, Liu J, Jin Y, Yin Y.. (2019) Discovery of 2,4-diarylaminopyrimidine derivatives bearing dithiocarbamate moiety as novel FAK inhibitors with antitumor and anti-angiogenesis activities., 177 [PMID:31129452 ] [10.1016/j.ejmech.2019.05.048 ]