The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(((2-(3-Chlorophenyl)cyclopropyl)methyl)(propyl)amino)butyl)-2-naphthamide Hydrochloride ID: ALA4525624
PubChem CID: 155543189
Max Phase: Preclinical
Molecular Formula: C28H34Cl2N2O
Molecular Weight: 449.04
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCN(CCCCNC(=O)c1ccc2ccccc2c1)CC1CC1c1cccc(Cl)c1.Cl
Standard InChI: InChI=1S/C28H33ClN2O.ClH/c1-2-15-31(20-25-19-27(25)23-10-7-11-26(29)18-23)16-6-5-14-30-28(32)24-13-12-21-8-3-4-9-22(21)17-24;/h3-4,7-13,17-18,25,27H,2,5-6,14-16,19-20H2,1H3,(H,30,32);1H
Standard InChI Key: WMZQIFSWRNNLKA-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
18.1123 -11.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8309 -11.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5495 -11.8832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2640 -11.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9826 -11.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7012 -11.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2831 -11.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6956 -12.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5645 -11.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5694 -10.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8516 -10.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1320 -10.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1347 -11.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8531 -11.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4165 -11.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1301 -11.4639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8454 -11.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5591 -11.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8469 -12.7001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2707 -11.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2626 -10.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5523 -10.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9828 -10.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9804 -11.4605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6923 -11.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4071 -11.4622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4055 -10.6343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6930 -10.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5506 -12.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2656 -13.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2666 -13.9447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8520 -9.3988 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.8497 -14.3040 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 1 1 0
8 7 1 0
1 8 1 0
7 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
6 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 2 0
20 24 1 0
23 21 1 0
21 22 2 0
22 18 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 23 2 0
3 29 1 0
29 30 1 0
30 31 1 0
11 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.04Molecular Weight (Monoisotopic): 448.2281AlogP: 6.52#Rotatable Bonds: 11Polar Surface Area: 32.34Molecular Species: BASEHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.44CX LogP: 6.32CX LogD: 3.41Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: -0.90
References 1. Tan L, Zhou Q, Yan W, Sun J, Kozikowski AP, Zhao S, Huang XP, Cheng J.. (2020) Design and Synthesis of Bitopic 2-Phenylcyclopropylmethylamine (PCPMA) Derivatives as Selective Dopamine D3 Receptor Ligands., 63 (9): [PMID:32282200 ] [10.1021/acs.jmedchem.9b01835 ]