The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Fluoro-4-(4-octylpiperazine-1-carboxamido)phenyl sulfamate ID: ALA4525656
PubChem CID: 155543227
Max Phase: Preclinical
Molecular Formula: C19H31FN4O4S
Molecular Weight: 430.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCN1CCN(C(=O)Nc2ccc(OS(N)(=O)=O)cc2F)CC1
Standard InChI: InChI=1S/C19H31FN4O4S/c1-2-3-4-5-6-7-10-23-11-13-24(14-12-23)19(25)22-18-9-8-16(15-17(18)20)28-29(21,26)27/h8-9,15H,2-7,10-14H2,1H3,(H,22,25)(H2,21,26,27)
Standard InChI Key: CMKNRRAHVCSWAC-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
28.5769 -15.8114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1725 -15.1057 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.7635 -15.8088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3439 -15.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3427 -15.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0508 -16.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7605 -15.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7576 -15.1144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0490 -14.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6347 -16.3456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9273 -15.9364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2193 -16.3445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9280 -15.1192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5147 -15.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8088 -16.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8039 -17.1521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5111 -17.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2232 -17.1572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4638 -14.7031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8792 -14.6978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0943 -17.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0906 -18.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7964 -18.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5060 -18.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2118 -18.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9214 -18.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6272 -18.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3368 -18.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6361 -14.7096 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
12 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
8 19 1 0
19 2 1 0
2 20 1 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
4 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.55Molecular Weight (Monoisotopic): 430.2050AlogP: 2.92#Rotatable Bonds: 10Polar Surface Area: 104.97Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.53CX Basic pKa: 7.58CX LogP: 3.06CX LogD: 2.66Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.56Np Likeness Score: -1.64
References 1. Moi D, Foster PA, Rimmer LG, Jaffri A, Deplano A, Balboni G, Onnis V, Potter BVL.. (2019) Synthesis and in vitro evaluation of piperazinyl-ureido sulfamates as steroid sulfatase inhibitors., 182 [PMID:31422224 ] [10.1016/j.ejmech.2019.111614 ]