(4Z,7Z,10Z,13Z,16Z,19Z)-N-(4-Chlorophenylsulfonyl)docosa-4,7,10,13,16,19-hexaenamide

ID: ALA4525859

PubChem CID: 155543254

Max Phase: Preclinical

Molecular Formula: C28H36ClNO3S

Molecular Weight: 502.12

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NS(=O)(=O)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C28H36ClNO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(31)30-34(32,33)27-24-22-26(29)23-25-27/h3-4,6-7,9-10,12-13,15-16,18-19,22-25H,2,5,8,11,14,17,20-21H2,1H3,(H,30,31)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-

Standard InChI Key:  GYWITAPHEDGMBB-KUBAVDMBSA-N

Molfile:  

 
     RDKit          2D

 34 34  0  0  0  0  0  0  0  0999 V2000
   27.2521  -14.2224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8476  -13.5167    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.4387  -14.2198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2715  -13.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9834  -13.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6911  -13.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4029  -13.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5597  -13.1122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2715  -14.3462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1114  -13.5195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1129  -14.3367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8213  -14.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8228  -15.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1159  -15.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1174  -16.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4104  -17.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7019  -16.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9950  -17.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2865  -16.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2850  -15.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5766  -15.5690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8696  -15.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8711  -16.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1642  -17.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1625  -18.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8694  -18.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5779  -18.0224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1443  -13.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1502  -12.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4477  -11.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7425  -12.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7443  -13.1129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4474  -13.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0347  -11.8877    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  4  8  1  0
  4  9  2  0
  7 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
  8  2  1  0
  2 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4525859

    ---

Associated Targets(non-human)

RBL-2H3 (1162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.12Molecular Weight (Monoisotopic): 501.2104AlogP: 7.62#Rotatable Bonds: 16
Polar Surface Area: 63.24Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.24CX Basic pKa: CX LogP: 8.15CX LogD: 7.21
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: 0.00

References

1. Kim IH, Kanayama Y, Nishiwaki H, Sugahara T, Nishi K..  (2019)  Structure-Activity Relationships of Fish Oil Derivatives with Antiallergic Activity in Vitro and in Vivo.,  62  (21): [PMID:31618024] [10.1021/acs.jmedchem.9b00994]

Source