6-(3-butyl-2-oxo-5-phenyl-2,3-dihydro-1H-imidazol-1-yl)-1-ethyl-4-(morpholin-4-yl)quinolin-2(1H)-one

ID: ALA4525967

PubChem CID: 138461742

Max Phase: Preclinical

Molecular Formula: C28H32N4O3

Molecular Weight: 472.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCn1cc(-c2ccccc2)n(-c2ccc3c(c2)c(N2CCOCC2)cc(=O)n3CC)c1=O

Standard InChI:  InChI=1S/C28H32N4O3/c1-3-5-13-30-20-26(21-9-7-6-8-10-21)32(28(30)34)22-11-12-24-23(18-22)25(19-27(33)31(24)4-2)29-14-16-35-17-15-29/h6-12,18-20H,3-5,13-17H2,1-2H3

Standard InChI Key:  DDLWZLRSTKCUOG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   21.2179   -8.8033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2357   -9.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2299  -10.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2061  -11.1307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1884  -10.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2054  -11.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1878  -10.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1935   -9.3597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2172   -8.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1942   -9.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2048  -11.1104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1456  -10.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3655  -11.4686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9320  -12.4923    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0765  -12.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9300  -13.0332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4775  -13.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2928  -13.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8383  -14.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6947  -14.8033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9064   -9.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8057   -9.1384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5665   -7.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4278   -7.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5284   -7.5955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7678   -8.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2003  -12.2739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2182  -12.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2122  -14.0347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1886  -14.6012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1707  -14.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1767  -12.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2185   -8.8135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2236   -7.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2475   -7.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 10  1  0
  5 10  2  0
  7 11  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  1  0
 15 11  1  0
 15 16  2  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 12 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
  4 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 27 32  1  0
  2 33  2  0
  1 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4525967

    ---

Associated Targets(Human)

HUVEC (11049 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.59Molecular Weight (Monoisotopic): 472.2474AlogP: 4.28#Rotatable Bonds: 7
Polar Surface Area: 61.40Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.81CX LogP: 3.41CX LogD: 3.41
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -1.30

References

1.  (2018)  Nitrogen-containing heterocyclic compound, 

Source