The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(4-(1H-pyrazol-1-yl)benzyl)-7-(3-(aminomethyl)pyrrolidin-1-yl)-6-fluoro-8-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA4525971
PubChem CID: 134603928
Max Phase: Preclinical
Molecular Formula: C26H26FN5O4
Molecular Weight: 491.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(N2CC[C@@H](CN)C2)c(F)cc2c(=O)c(C(=O)O)cn(Cc3ccc(-n4cccn4)cc3)c12
Standard InChI: InChI=1S/C26H26FN5O4/c1-36-25-22-19(11-21(27)23(25)30-10-7-17(12-28)14-30)24(33)20(26(34)35)15-31(22)13-16-3-5-18(6-4-16)32-9-2-8-29-32/h2-6,8-9,11,15,17H,7,10,12-14,28H2,1H3,(H,34,35)/t17-/m0/s1
Standard InChI Key: KXJSFHKTIWDXKT-KRWDZBQOSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
16.8831 -2.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8819 -3.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5900 -3.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5882 -1.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2968 -2.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2956 -3.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0018 -3.5084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7137 -3.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7149 -2.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0042 -1.8671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0042 -1.0499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4236 -1.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1303 -2.2841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4256 -1.0567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9996 -4.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7061 -4.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7025 -5.5522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4082 -5.9627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1180 -5.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1177 -4.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4114 -4.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8234 -5.9638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1753 -1.8739 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.1739 -3.5099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5916 -4.3280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8848 -4.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9077 -6.7711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7045 -6.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1124 -6.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5675 -5.6299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4322 -3.1761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8849 -3.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2929 -4.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0924 -4.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0722 -3.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5914 -4.3576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
9 12 1 0
12 13 1 0
12 14 2 0
7 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
1 23 1 0
2 24 1 0
3 25 1 0
25 26 1 0
22 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 22 1 0
24 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 24 1 0
32 35 1 1
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.52Molecular Weight (Monoisotopic): 491.1969AlogP: 2.87#Rotatable Bonds: 7Polar Surface Area: 115.61Molecular Species: ZWITTERIONHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.63CX Basic pKa: 9.63CX LogP: 0.28CX LogD: 0.28Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.41Np Likeness Score: -1.36
References 1. Delgado JL, Lentz SRC, Kulkarni CA, Chheda PR, Held HA, Hiasa H, Kerns RJ.. (2019) Probing structural requirements for human topoisomerase I inhibition by a novel N1-Biphenyl fluoroquinolone., 172 [PMID:30959322 ] [10.1016/j.ejmech.2019.03.040 ]