(S)-1-(4-(1H-pyrazol-1-yl)benzyl)-7-(3-(aminomethyl)pyrrolidin-1-yl)-6-fluoro-8-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

ID: ALA4525971

PubChem CID: 134603928

Max Phase: Preclinical

Molecular Formula: C26H26FN5O4

Molecular Weight: 491.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1c(N2CC[C@@H](CN)C2)c(F)cc2c(=O)c(C(=O)O)cn(Cc3ccc(-n4cccn4)cc3)c12

Standard InChI:  InChI=1S/C26H26FN5O4/c1-36-25-22-19(11-21(27)23(25)30-10-7-17(12-28)14-30)24(33)20(26(34)35)15-31(22)13-16-3-5-18(6-4-16)32-9-2-8-29-32/h2-6,8-9,11,15,17H,7,10,12-14,28H2,1H3,(H,34,35)/t17-/m0/s1

Standard InChI Key:  KXJSFHKTIWDXKT-KRWDZBQOSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   16.8831   -2.2823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8819   -3.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5900   -3.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5882   -1.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2968   -2.2787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2956   -3.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0018   -3.5084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7137   -3.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7149   -2.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0042   -1.8671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0042   -1.0499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4236   -1.8738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1303   -2.2841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4256   -1.0567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9996   -4.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7061   -4.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7025   -5.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4082   -5.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1180   -5.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1177   -4.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4114   -4.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8234   -5.9638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1753   -1.8739    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.1739   -3.5099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5916   -4.3280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8848   -4.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9077   -6.7711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7045   -6.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1124   -6.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5675   -5.6299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4322   -3.1761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8849   -3.7829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2929   -4.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0924   -4.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0722   -3.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5914   -4.3576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
  9 12  1  0
 12 13  1  0
 12 14  2  0
  7 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
  1 23  1  0
  2 24  1  0
  3 25  1  0
 25 26  1  0
 22 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 22  1  0
 24 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 24  1  0
 32 35  1  1
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4525971

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.52Molecular Weight (Monoisotopic): 491.1969AlogP: 2.87#Rotatable Bonds: 7
Polar Surface Area: 115.61Molecular Species: ZWITTERIONHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.63CX Basic pKa: 9.63CX LogP: 0.28CX LogD: 0.28
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.41Np Likeness Score: -1.36

References

1. Delgado JL, Lentz SRC, Kulkarni CA, Chheda PR, Held HA, Hiasa H, Kerns RJ..  (2019)  Probing structural requirements for human topoisomerase I inhibition by a novel N1-Biphenyl fluoroquinolone.,  172  [PMID:30959322] [10.1016/j.ejmech.2019.03.040]

Source