5-(6-(methylamino)pyridin-2-yl)-N-(4-morpholinophenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine

ID: ALA4526033

PubChem CID: 155543350

Max Phase: Preclinical

Molecular Formula: C28H27N7O2

Molecular Weight: 493.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNc1cccc(-c2c[nH]c3nc(Nc4ccc(N5CCOCC5)cc4)nc(Oc4ccccc4)c23)n1

Standard InChI:  InChI=1S/C28H27N7O2/c1-29-24-9-5-8-23(32-24)22-18-30-26-25(22)27(37-21-6-3-2-4-7-21)34-28(33-26)31-19-10-12-20(13-11-19)35-14-16-36-17-15-35/h2-13,18H,14-17H2,1H3,(H,29,32)(H2,30,31,33,34)

Standard InChI Key:  QNIIEQKQSNMWMP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   40.7385  -25.2751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7373  -26.0946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4454  -26.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4436  -24.8663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.1522  -25.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1570  -26.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9370  -26.3386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4144  -25.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9293  -25.0141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.0307  -24.8667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.3230  -25.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6154  -24.8653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9082  -25.2734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9080  -26.0914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6208  -26.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3250  -26.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2009  -26.5011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4464  -27.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.7392  -27.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4941  -26.0895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7892  -26.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7862  -27.3133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4944  -27.7229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2055  -27.3151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0342  -27.3221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3275  -27.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3282  -28.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0414  -28.9565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7451  -28.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1928  -27.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6477  -27.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9042  -28.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7053  -28.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2494  -28.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9900  -27.2730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.0503  -28.2081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.3101  -28.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
  3 18  1  0
 18 19  1  0
 17 20  1  0
 17 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 19 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 19  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
  7 30  1  0
 34 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4526033

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.57Molecular Weight (Monoisotopic): 493.2226AlogP: 5.43#Rotatable Bonds: 7
Polar Surface Area: 100.22Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.24CX Basic pKa: 6.41CX LogP: 5.50CX LogD: 5.50
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -1.19

References

1. Tang G, Liu L, Wang X, Pan Z..  (2019)  Discovery of 7H-pyrrolo[2,3-d]pyrimidine derivatives as selective covalent irreversible inhibitors of interleukin-2-inducible T-cell kinase (Itk).,  173  [PMID:30999237] [10.1016/j.ejmech.2019.03.055]

Source