N-(2,2-diphenylethyl)-3-hydroxy-1,5-dimethyl-1H-pyrazole-4-carboxamide

ID: ALA4526067

PubChem CID: 155543416

Max Phase: Preclinical

Molecular Formula: C20H21N3O2

Molecular Weight: 335.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C(=O)NCC(c2ccccc2)c2ccccc2)c(O)nn1C

Standard InChI:  InChI=1S/C20H21N3O2/c1-14-18(20(25)22-23(14)2)19(24)21-13-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13H2,1-2H3,(H,21,24)(H,22,25)

Standard InChI Key:  XNUZSJRRIGQEKJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   11.2805  -11.1935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9435  -10.7156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6891   -9.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8719   -9.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6176  -10.7156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3953   -9.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1045   -9.9294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3922   -8.7063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8107   -9.5181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5199   -9.9241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5230  -10.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2261   -9.5128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8168  -11.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8195  -11.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5293  -12.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2378  -11.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2316  -11.1426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9313   -9.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6370   -9.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6344   -8.6918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9202   -8.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2174   -8.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3918   -9.2734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2805  -12.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7203  -10.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  2  0
  2  3  2  0
  1  2  1  0
  3  4  1  0
  5  1  1  0
  3  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 11 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 11  1  0
 12 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 12  1  0
  4 23  1  0
  1 24  1  0
  2 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4526067

    ---

Associated Targets(Human)

DHODH Tclin Dihydroorotate dehydrogenase (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

COS-7 (515 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
dhod Dihydroorotate dehydrogenase (710 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 335.41Molecular Weight (Monoisotopic): 335.1634AlogP: 3.00#Rotatable Bonds: 5
Polar Surface Area: 67.15Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 5.36CX Basic pKa: 0.87CX LogP: 4.13CX LogD: 2.57
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.75Np Likeness Score: -1.00

References

1. Pippione AC, Sainas S, Goyal P, Fritzson I, Cassiano GC, Giraudo A, Giorgis M, Tavella TA, Bagnati R, Rolando B, Caing-Carlsson R, Costa FTM, Andrade CH, Al-Karadaghi S, Boschi D, Friemann R, Lolli ML..  (2019)  Hydroxyazole scaffold-based Plasmodium falciparum dihydroorotate dehydrogenase inhibitors: Synthesis, biological evaluation and X-ray structural studies.,  163  [PMID:30529545] [10.1016/j.ejmech.2018.11.044]

Source