(E)-1-(4-(3-(Pyrrolidin-1-yl)propoxy)phenyl)-3-(2-(trifluoromethyl)phenyl)prop-2-en-1-one hydrochloride

ID: ALA4526218

PubChem CID: 155544017

Max Phase: Preclinical

Molecular Formula: C23H25ClF3NO2

Molecular Weight: 403.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.O=C(/C=C/c1ccccc1C(F)(F)F)c1ccc(OCCCN2CCCC2)cc1

Standard InChI:  InChI=1S/C23H24F3NO2.ClH/c24-23(25,26)21-7-2-1-6-18(21)10-13-22(28)19-8-11-20(12-9-19)29-17-5-16-27-14-3-4-15-27;/h1-2,6-13H,3-5,14-17H2;1H/b13-10+;

Standard InChI Key:  ZLXLFJYLZSRJMP-RSGUCCNWSA-N

Molfile:  

     RDKit          2D

 30 31  0  0  0  0  0  0  0  0999 V2000
   31.6558   -5.3489    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   33.8588   -3.0082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8577   -3.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5657   -4.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2754   -3.8273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2726   -3.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5639   -2.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9787   -2.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6880   -2.9993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3941   -2.5880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1034   -2.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1034   -3.8100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8118   -4.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5189   -3.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5132   -2.9831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8042   -2.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9756   -1.7762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1497   -4.2358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4423   -3.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7342   -4.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0269   -3.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3188   -4.2335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5714   -3.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0241   -4.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4322   -5.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2316   -5.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7975   -1.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5018   -1.3494    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.0864   -1.3611    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.7918   -0.9451    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 17  2  0
  3 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 22  1  0
 16 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Associated Targets(Human)

NFE2L2 Tchem Keap1/Nrf2 (1722 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.44Molecular Weight (Monoisotopic): 403.1759AlogP: 5.47#Rotatable Bonds: 8
Polar Surface Area: 29.54Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.65CX LogP: 5.09CX LogD: 3.82
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.33Np Likeness Score: -1.07

References

1. Kim HJ, Jang BK, Park JH, Choi JW, Park SJ, Byeon SR, Pae AN, Lee YS, Cheong E, Park KD..  (2020)  A novel chalcone derivative as Nrf2 activator attenuates learning and memory impairment in a scopolamine-induced mouse model.,  185  [PMID:31670201] [10.1016/j.ejmech.2019.111777]

Source