The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(4-(3-(Pyrrolidin-1-yl)propoxy)phenyl)-3-(2-(trifluoromethyl)phenyl)prop-2-en-1-one hydrochloride ID: ALA4526218
PubChem CID: 155544017
Max Phase: Preclinical
Molecular Formula: C23H25ClF3NO2
Molecular Weight: 403.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=C(/C=C/c1ccccc1C(F)(F)F)c1ccc(OCCCN2CCCC2)cc1
Standard InChI: InChI=1S/C23H24F3NO2.ClH/c24-23(25,26)21-7-2-1-6-18(21)10-13-22(28)19-8-11-20(12-9-19)29-17-5-16-27-14-3-4-15-27;/h1-2,6-13H,3-5,14-17H2;1H/b13-10+;
Standard InChI Key: ZLXLFJYLZSRJMP-RSGUCCNWSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
31.6558 -5.3489 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.8588 -3.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8577 -3.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5657 -4.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2754 -3.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2726 -3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5639 -2.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9787 -2.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6880 -2.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3941 -2.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1034 -2.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1034 -3.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8118 -4.2159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5189 -3.8045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5132 -2.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8042 -2.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9756 -1.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1497 -4.2358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4423 -3.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7342 -4.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0269 -3.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3188 -4.2335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5714 -3.9038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0241 -4.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4322 -5.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2316 -5.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7975 -1.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5018 -1.3494 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.0864 -1.3611 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.7918 -0.9451 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
8 17 2 0
3 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
16 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 403.44Molecular Weight (Monoisotopic): 403.1759AlogP: 5.47#Rotatable Bonds: 8Polar Surface Area: 29.54Molecular Species: BASEHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.65CX LogP: 5.09CX LogD: 3.82Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.33Np Likeness Score: -1.07
References 1. Kim HJ, Jang BK, Park JH, Choi JW, Park SJ, Byeon SR, Pae AN, Lee YS, Cheong E, Park KD.. (2020) A novel chalcone derivative as Nrf2 activator attenuates learning and memory impairment in a scopolamine-induced mouse model., 185 [PMID:31670201 ] [10.1016/j.ejmech.2019.111777 ]