The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-{[(5-Chloro-8-hydroxyquinolin-7-yl)methyl]amino}-N-[2-(2-methyl-1H-indol-3-yl)ethyl]propanamide ID: ALA4526272
PubChem CID: 155544079
Max Phase: Preclinical
Molecular Formula: C24H25ClN4O2
Molecular Weight: 436.94
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c2ccccc2c1CCNC(=O)CCNCc1cc(Cl)c2cccnc2c1O
Standard InChI: InChI=1S/C24H25ClN4O2/c1-15-17(18-5-2-3-7-21(18)29-15)8-12-27-22(30)9-11-26-14-16-13-20(25)19-6-4-10-28-23(19)24(16)31/h2-7,10,13,26,29,31H,8-9,11-12,14H2,1H3,(H,27,30)
Standard InChI Key: GOABROPOBRHMRM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
17.9768 -14.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9756 -15.1534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6878 -15.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6860 -13.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3946 -14.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3954 -15.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1081 -15.5563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8205 -15.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8157 -14.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1025 -13.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6897 -16.3836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6836 -13.0954 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.2635 -15.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5520 -15.1522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8398 -15.5603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1283 -15.1511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4161 -15.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7046 -15.1500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4155 -16.3805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7053 -14.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4174 -13.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4181 -13.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0065 -11.8270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7494 -12.6081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8279 -11.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0777 -12.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8769 -12.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4271 -12.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1685 -11.3914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3699 -11.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9721 -12.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 11 1 0
4 12 1 0
2 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 26 1 0
25 23 1 0
23 24 1 0
24 22 2 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
24 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.94Molecular Weight (Monoisotopic): 436.1666AlogP: 4.22#Rotatable Bonds: 8Polar Surface Area: 90.04Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.12CX Basic pKa: 9.59CX LogP: 2.36CX LogD: 2.24Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -0.97
References 1. Chen C, Yang X, Fang H, Hou X.. (2019) Design, synthesis and preliminary bioactivity evaluations of 8-hydroxyquinoline derivatives as matrix metalloproteinase (MMP) inhibitors., 181 [PMID:31415980 ] [10.1016/j.ejmech.2019.111563 ]