The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(7-(3-hydroxy-3-methylpyrrolidin-1-yl)pyrido[3,2-d]pyrimidin-4-yl)piperidin-1-yl)(4-(trifluoromethoxy)phenyl)methanone ID: ALA4526317
PubChem CID: 139473441
Max Phase: Preclinical
Molecular Formula: C25H26F3N5O3
Molecular Weight: 501.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(O)CCN(c2cnc3c(C4CCN(C(=O)c5ccc(OC(F)(F)F)cc5)CC4)ncnc3c2)C1
Standard InChI: InChI=1S/C25H26F3N5O3/c1-24(35)8-11-33(14-24)18-12-20-22(29-13-18)21(31-15-30-20)16-6-9-32(10-7-16)23(34)17-2-4-19(5-3-17)36-25(26,27)28/h2-5,12-13,15-16,35H,6-11,14H2,1H3
Standard InChI Key: OFHDGXMKRRHYRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
21.5978 -30.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3077 -29.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6024 -29.2003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2703 -22.8112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1516 -23.2280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1505 -24.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8585 -24.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5682 -24.0471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5654 -23.2244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8567 -22.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4424 -24.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7351 -24.0464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4418 -25.2728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7321 -25.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7295 -26.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4351 -26.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1449 -26.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1492 -25.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4313 -27.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4226 -29.3512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1346 -28.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1351 -28.1264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7163 -28.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7223 -28.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0203 -27.7120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3118 -28.1151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3096 -28.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0122 -29.3411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2649 -21.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9699 -21.5808 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.5545 -21.5901 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.2579 -21.1768 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.6010 -29.3406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8567 -29.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7155 -30.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5151 -30.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
6 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
16 19 1 0
19 24 2 0
23 20 2 0
20 21 1 0
21 22 2 0
22 19 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
9 4 1 0
4 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
27 33 1 0
33 34 1 0
34 2 1 0
2 35 1 0
35 36 1 0
36 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.51Molecular Weight (Monoisotopic): 501.1988AlogP: 3.90#Rotatable Bonds: 4Polar Surface Area: 91.68Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.35CX LogP: 3.37CX LogD: 3.37Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.58Np Likeness Score: -0.84
References 1. Nguyen D, Lemos C, Wortmann L, Eis K, Holton SJ, Boemer U, Moosmayer D, Eberspaecher U, Weiske J, Lechner C, Prechtl S, Suelzle D, Siegel F, Prinz F, Lesche R, Nicke B, Nowak-Reppel K, Himmel H, Mumberg D, von Nussbaum F, Nising CF, Bauser M, Haegebarth A.. (2019) Discovery and Characterization of the Potent and Highly Selective (Piperidin-4-yl)pyrido[3,2- d]pyrimidine Based in Vitro Probe BAY-885 for the Kinase ERK5., 62 (2): [PMID:30563338 ] [10.1021/acs.jmedchem.8b01606 ]