1'-[[1-(2-methylsulfonylethyl)indol-2-yl]methyl]spiro[cyclopropane-1,3'-pyrrolo[2,3-c]pyridine]-2'-one

ID: ALA4526386

PubChem CID: 86292718

Max Phase: Preclinical

Molecular Formula: C21H21N3O3S

Molecular Weight: 395.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)CCn1c(CN2C(=O)C3(CC3)c3ccncc32)cc2ccccc21

Standard InChI:  InChI=1S/C21H21N3O3S/c1-28(26,27)11-10-23-16(12-15-4-2-3-5-18(15)23)14-24-19-13-22-9-6-17(19)21(7-8-21)20(24)25/h2-6,9,12-13H,7-8,10-11,14H2,1H3

Standard InChI Key:  KHHLCYXJSGSSBR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    7.4461   -6.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6248   -6.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0333   -6.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4565   -5.3683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6447   -5.2862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2358   -4.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4186   -4.5790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9376   -5.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1590   -4.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4519   -5.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7397   -4.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7408   -4.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4501   -3.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1587   -4.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9372   -3.9169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1894   -3.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9887   -2.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2380   -2.1885    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.5281   -1.7799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2369   -1.3694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0402   -2.0220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3136   -6.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9192   -6.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7513   -7.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9787   -7.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3681   -7.0782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5386   -6.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0027   -4.7605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  2  4  1  0
  4  5  1  0
  6  5  1  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 14  9  1  0
 15 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 20 18  2  0
 18 21  1  0
  5 22  1  0
 23 22  2  0
 23  2  1  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
  4 28  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

HEp-2 (3859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Respiratory syncytial virus (3434 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.48Molecular Weight (Monoisotopic): 395.1304AlogP: 2.66#Rotatable Bonds: 5
Polar Surface Area: 72.27Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.23CX LogP: 1.00CX LogD: 1.00
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.67Np Likeness Score: -0.78

References

1. Zheng X, Liang C, Wang L, Miao K, Wang B, Zhang W, Chen D, Wu G, Zhu W, Guo L, Feng S, Gao L, Shen HC, Yun H..  (2019)  Discovery of (aza)indole derivatives as novel respiratory syncytial virus fusion inhibitors.,  10  (6): [PMID:31303995] [10.1039/C9MD00178F]

Source