The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl ((S)-4-Methyl-1-oxo-1-(((S,E)-5-phenyl-1-(pyridin-2-yl)pent-1-en-3-yl)amino)pentan-2-yl)carbamate ID: ALA4526486
PubChem CID: 155544114
Max Phase: Preclinical
Molecular Formula: C30H35N3O3
Molecular Weight: 485.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](/C=C/c1ccccn1)CCc1ccccc1
Standard InChI: InChI=1S/C30H35N3O3/c1-23(2)21-28(33-30(35)36-22-25-13-7-4-8-14-25)29(34)32-27(17-16-24-11-5-3-6-12-24)19-18-26-15-9-10-20-31-26/h3-15,18-20,23,27-28H,16-17,21-22H2,1-2H3,(H,32,34)(H,33,35)/b19-18+/t27-,28-/m0/s1
Standard InChI Key: BGUNREWIECUDAA-JTTKXWLOSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
10.7721 -7.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4043 -7.4861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1105 -7.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8197 -7.4807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1074 -6.2576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5259 -7.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2351 -7.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9413 -7.0642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2382 -8.2926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6505 -7.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3567 -7.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6536 -8.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0659 -7.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5228 -6.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2290 -5.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9358 -6.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2219 -5.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4809 -7.4622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1865 -7.0516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1838 -6.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4696 -5.8279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7669 -6.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3629 -8.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3609 -9.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6508 -9.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6485 -10.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3556 -11.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0665 -10.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0653 -9.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6965 -7.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9925 -7.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2879 -7.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5843 -7.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5850 -8.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2951 -8.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9958 -8.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
3 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
10 12 1 6
11 13 2 0
13 1 1 0
6 14 1 1
14 15 1 0
15 16 1 0
17 15 1 0
1 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 1 1 0
12 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
2 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.63Molecular Weight (Monoisotopic): 485.2678AlogP: 5.55#Rotatable Bonds: 12Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.51CX Basic pKa: 4.74CX LogP: 6.12CX LogD: 6.12Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -0.21
References 1. Chenna BC, Li L, Mellott DM, Zhai X, Siqueira-Neto JL, Calvet Alvarez C, Bernatchez JA, Desormeaux E, Alvarez Hernandez E, Gomez J, McKerrow JH, Cruz-Reyes J, Meek TD.. (2020) Peptidomimetic Vinyl Heterocyclic Inhibitors of Cruzain Effect Antitrypanosomal Activity., 63 (6): [PMID:32125159 ] [10.1021/acs.jmedchem.9b02078 ]