1-([1,1'-biphenyl]-4-ylmethyl)-6-fluoro-7-((3-(methylamino)propyl)amino)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

ID: ALA4526574

PubChem CID: 134603997

Max Phase: Preclinical

Molecular Formula: C27H26FN3O3

Molecular Weight: 459.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNCCCNc1cc2c(cc1F)c(=O)c(C(=O)O)cn2Cc1ccc(-c2ccccc2)cc1

Standard InChI:  InChI=1S/C27H26FN3O3/c1-29-12-5-13-30-24-15-25-21(14-23(24)28)26(32)22(27(33)34)17-31(25)16-18-8-10-20(11-9-18)19-6-3-2-4-7-19/h2-4,6-11,14-15,17,29-30H,5,12-13,16H2,1H3,(H,33,34)

Standard InChI Key:  SWCXTSVBPJBWNP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   18.6041  -17.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6030  -18.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3110  -18.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3092  -17.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0179  -17.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0167  -18.3165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7229  -18.7255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4348  -18.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4359  -17.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7252  -17.0842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7252  -16.2670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1446  -17.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8513  -17.5012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1466  -16.2737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7206  -19.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4272  -19.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4235  -20.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1293  -21.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8391  -20.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8388  -19.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1324  -19.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5444  -21.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5419  -21.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2482  -22.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9575  -22.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9560  -21.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2492  -20.7739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8963  -17.0910    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.8950  -18.7270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1876  -18.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4795  -18.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7722  -18.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0641  -18.7247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3567  -18.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
  9 12  1  0
 12 13  1  0
 12 14  2  0
  7 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 19 22  1  0
  1 28  1  0
  2 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4526574

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.52Molecular Weight (Monoisotopic): 459.1958AlogP: 4.58#Rotatable Bonds: 9
Polar Surface Area: 83.36Molecular Species: ZWITTERIONHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.84CX Basic pKa: 10.12CX LogP: 1.59CX LogD: 1.58
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -0.84

References

1. Delgado JL, Lentz SRC, Kulkarni CA, Chheda PR, Held HA, Hiasa H, Kerns RJ..  (2019)  Probing structural requirements for human topoisomerase I inhibition by a novel N1-Biphenyl fluoroquinolone.,  172  [PMID:30959322] [10.1016/j.ejmech.2019.03.040]

Source