2-(3-(2,4-dichlorobenzyloxy)-2-nitrobenzoyl)-3-hydroxycyclohex-2-en-1-one

ID: ALA4526579

PubChem CID: 155544224

Max Phase: Preclinical

Molecular Formula: C20H15Cl2NO6

Molecular Weight: 436.25

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CCCC(O)=C1C(=O)c1cccc(OCc2ccc(Cl)cc2Cl)c1[N+](=O)[O-]

Standard InChI:  InChI=1S/C20H15Cl2NO6/c21-12-8-7-11(14(22)9-12)10-29-17-6-1-3-13(19(17)23(27)28)20(26)18-15(24)4-2-5-16(18)25/h1,3,6-9,24H,2,4-5,10H2

Standard InChI Key:  NBUPTYNWLVUUKL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   30.8964  -10.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7345   -9.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7334  -10.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4414  -10.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1511  -10.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1483   -9.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4397   -9.1869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0267   -9.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0265   -8.3702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3191   -9.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6095   -9.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9040   -9.5859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6076  -10.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3193  -10.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6128   -8.3634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0262  -10.8171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8544   -9.1809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5637   -9.5868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2699   -9.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9775   -9.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6832   -9.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6806   -8.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9663   -7.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2636   -8.3634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4372   -8.3697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1437   -7.9590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7283   -7.9632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3862   -7.9441    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   37.9786  -10.4021    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  2  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  2  0
 10 14  1  0
 11 12  1  0
 12  1  1  0
  1 13  1  0
 13 14  1  0
 11 15  1  0
 14 16  2  0
  6 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  7 25  1  0
 25 26  1  0
 25 27  2  0
 22 28  1  0
 20 29  1  0
M  CHG  2  25   1  26  -1
M  END

Alternative Forms

  1. Parent:

    ALA4526579

    ---

Associated Targets(Human)

HPD Tclin 4-hydroxyphenylpyruvate dioxygenase (117 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.25Molecular Weight (Monoisotopic): 435.0276AlogP: 5.23#Rotatable Bonds: 6
Polar Surface Area: 106.74Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.93CX Basic pKa: CX LogP: 4.72CX LogD: 1.52
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.29Np Likeness Score: -0.63

References

1. Ndikuryayo F, Kang WM, Wu FX, Yang WC, Yang GF..  (2019)  Hydrophobicity-oriented drug design (HODD) of new human 4-hydroxyphenylpyruvate dioxygenase inhibitors.,  166  [PMID:30684868] [10.1016/j.ejmech.2019.01.032]

Source