The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-acetoxymethyl-5-[(E)-2-formylethen-1-yl]-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-2,3-dihydrobenzofuran ID: ALA4526707
PubChem CID: 10644549
Max Phase: Preclinical
Molecular Formula: C22H22O7
Molecular Weight: 398.41
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2Oc3c(OC)cc(/C=C/C=O)cc3[C@H]2COC(C)=O)ccc1O
Standard InChI: InChI=1S/C22H22O7/c1-13(24)28-12-17-16-9-14(5-4-8-23)10-20(27-3)22(16)29-21(17)15-6-7-18(25)19(11-15)26-2/h4-11,17,21,25H,12H2,1-3H3/b5-4+/t17-,21+/m1/s1
Standard InChI Key: RATHWHQMVNHBER-FLWKIERCSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
8.7373 -21.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4538 -21.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4509 -20.3049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7355 -19.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0225 -21.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0192 -20.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2341 -20.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7523 -20.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2395 -21.3937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9318 -20.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5171 -20.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6928 -20.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2824 -20.7382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7023 -21.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5251 -21.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4574 -20.7426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2777 -19.3084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6876 -18.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9761 -19.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5256 -18.6610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7371 -22.3738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0225 -22.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2676 -17.8775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8172 -17.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4599 -17.7092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1639 -19.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8783 -20.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5928 -19.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3073 -20.3022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 1
13 16 1 0
12 17 1 0
17 18 1 0
7 19 1 6
19 20 1 0
1 21 1 0
21 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
3 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.41Molecular Weight (Monoisotopic): 398.1366AlogP: 3.40#Rotatable Bonds: 7Polar Surface Area: 91.29Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.91CX Basic pKa: ┄CX LogP: 2.44CX LogD: 2.43Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.43Np Likeness Score: 1.91
References 1. Odonbayar B, Murata T, Suganuma K, Ishikawa Y, Buyankhishig B, Batkhuu J, Sasaki K.. (2019) Acylated Lignans Isolated from Brachanthemum gobicum and Their Trypanocidal Activity., 82 (4): [PMID:30896183 ] [10.1021/acs.jnatprod.8b00670 ]