3-morpholino-N-(3-(3-p-tolyl-1H-pyrazol-5-yl)phenyl)-4-(trifluoromethyl)benzamide

ID: ALA4526774

PubChem CID: 155544511

Max Phase: Preclinical

Molecular Formula: C28H25F3N4O2

Molecular Weight: 506.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc(-c3cccc(NC(=O)c4ccc(C(F)(F)F)c(N5CCOCC5)c4)c3)[nH]n2)cc1

Standard InChI:  InChI=1S/C28H25F3N4O2/c1-18-5-7-19(8-6-18)24-17-25(34-33-24)20-3-2-4-22(15-20)32-27(36)21-9-10-23(28(29,30)31)26(16-21)35-11-13-37-14-12-35/h2-10,15-17H,11-14H2,1H3,(H,32,36)(H,33,34)

Standard InChI Key:  JEKPBRRCLQRVQR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   15.9544  -16.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9533  -16.9817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6613  -17.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3710  -16.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3682  -16.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6596  -15.7533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2480  -17.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5017  -17.0601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9544  -17.6670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3625  -18.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1619  -18.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0794  -17.3887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7864  -16.9790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7851  -16.1618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4915  -17.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4914  -18.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1989  -18.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9070  -18.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9031  -17.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1950  -16.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0333  -19.1184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2193  -19.2020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8864  -19.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3664  -20.6099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1831  -20.5220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5123  -19.7764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0345  -21.3567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6175  -18.6053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2625  -18.9752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.7562  -19.4479    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.4149  -18.2995    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.2030  -19.4234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4939  -19.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4929  -20.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1992  -21.0569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9083  -20.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9110  -19.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  2  0
  2  7  1  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 10 21  1  0
 24 27  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
 18 28  1  0
 32 33  1  0
 32 37  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 17 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4526774

    ---

Associated Targets(Human)

RAF1 Tclin Serine/threonine-protein kinase RAF (4169 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRAF Tclin Serine/threonine-protein kinase B-raf (11587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.53Molecular Weight (Monoisotopic): 506.1930AlogP: 6.16#Rotatable Bonds: 5
Polar Surface Area: 70.25Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.62CX Basic pKa: 2.56CX LogP: 6.25CX LogD: 6.25
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.87

References

1. Jung H, Kim J, Im D, Moon H, Hah JM..  (2019)  Design, synthesis, and in vitro evaluation of N-(3-(3-alkyl-1H-pyrazol-5-yl) phenyl)-aryl amide for selective RAF inhibition.,  29  (4): [PMID:30630714] [10.1016/j.bmcl.2019.01.003]

Source