The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-morpholino-N-(3-(3-p-tolyl-1H-pyrazol-5-yl)phenyl)-4-(trifluoromethyl)benzamide ID: ALA4526774
PubChem CID: 155544511
Max Phase: Preclinical
Molecular Formula: C28H25F3N4O2
Molecular Weight: 506.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2cc(-c3cccc(NC(=O)c4ccc(C(F)(F)F)c(N5CCOCC5)c4)c3)[nH]n2)cc1
Standard InChI: InChI=1S/C28H25F3N4O2/c1-18-5-7-19(8-6-18)24-17-25(34-33-24)20-3-2-4-22(15-20)32-27(36)21-9-10-23(28(29,30)31)26(16-21)35-11-13-37-14-12-35/h2-10,15-17H,11-14H2,1H3,(H,32,36)(H,33,34)
Standard InChI Key: JEKPBRRCLQRVQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
15.9544 -16.1622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9533 -16.9817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6613 -17.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3710 -16.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3682 -16.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6596 -15.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2480 -17.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5017 -17.0601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9544 -17.6670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3625 -18.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1619 -18.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0794 -17.3887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7864 -16.9790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7851 -16.1618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4915 -17.3839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4914 -18.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1989 -18.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9070 -18.1998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9031 -17.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1950 -16.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0333 -19.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2193 -19.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8864 -19.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3664 -20.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1831 -20.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5123 -19.7764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0345 -21.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6175 -18.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2625 -18.9752 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.7562 -19.4479 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.4149 -18.2995 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.2030 -19.4234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4939 -19.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4929 -20.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1992 -21.0569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9083 -20.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9110 -19.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 2 0
2 7 1 0
4 12 1 0
12 13 1 0
13 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
10 21 1 0
24 27 1 0
28 29 1 0
28 30 1 0
28 31 1 0
18 28 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
17 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.53Molecular Weight (Monoisotopic): 506.1930AlogP: 6.16#Rotatable Bonds: 5Polar Surface Area: 70.25Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.62CX Basic pKa: 2.56CX LogP: 6.25CX LogD: 6.25Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.87
References 1. Jung H, Kim J, Im D, Moon H, Hah JM.. (2019) Design, synthesis, and in vitro evaluation of N-(3-(3-alkyl-1H-pyrazol-5-yl) phenyl)-aryl amide for selective RAF inhibition., 29 (4): [PMID:30630714 ] [10.1016/j.bmcl.2019.01.003 ]