5-(4-Nitrobenzamido)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic acid

ID: ALA4526840

PubChem CID: 155544120

Max Phase: Preclinical

Molecular Formula: C25H23N3O5

Molecular Weight: 445.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(NC(=O)c2ccc([N+](=O)[O-])cc2)cc(-c2ccc(C3CCNCC3)cc2)c1

Standard InChI:  InChI=1S/C25H23N3O5/c29-24(19-5-7-23(8-6-19)28(32)33)27-22-14-20(13-21(15-22)25(30)31)17-3-1-16(2-4-17)18-9-11-26-12-10-18/h1-8,13-15,18,26H,9-12H2,(H,27,29)(H,30,31)

Standard InChI Key:  CJKNCFNAAUTZKV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    6.2151  -24.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2140  -25.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9287  -25.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6452  -25.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6422  -24.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9269  -24.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9304  -26.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2143  -27.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2137  -27.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9285  -28.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6455  -27.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6425  -27.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9332  -29.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2173  -29.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2162  -30.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9293  -30.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6451  -30.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6479  -29.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3552  -24.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0711  -24.5528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3520  -23.3180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5005  -24.1495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7862  -24.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0716  -24.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7864  -25.3872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0751  -23.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3613  -22.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6461  -23.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6489  -24.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3631  -24.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9323  -22.9107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2185  -23.3243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9310  -22.0857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  2  0
 19 21  1  0
  1 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 24  1  0
 31 32  2  0
 31 33  1  0
 28 31  1  0
M  CHG  2  31   1  33  -1
M  END

Alternative Forms

  1. Parent:

    ALA4526840

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.48Molecular Weight (Monoisotopic): 445.1638AlogP: 4.68#Rotatable Bonds: 6
Polar Surface Area: 121.57Molecular Species: ZWITTERIONHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.84CX Basic pKa: 10.07CX LogP: 1.94CX LogD: 1.94
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -0.97

References

1. Zhang Z, Hao K, Li H, Lu R, Liu C, Zhou M, Li B, Meng Z, Hu Q, Jiang C..  (2019)  Design, synthesis and anti-inflammatory evaluation of 3-amide benzoic acid derivatives as novel P2Y14 receptor antagonists.,  181  [PMID:31376563] [10.1016/j.ejmech.2019.111564]

Source