omega-Hydroxyfentanyl

ID: ALA4526998

Cas Number: 83708-11-6

PubChem CID: 71748858

Max Phase: Preclinical

Molecular Formula: C22H28N2O2

Molecular Weight: 352.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCO)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1

Standard InChI:  InChI=1S/C22H28N2O2/c25-18-14-22(26)24(20-9-5-2-6-10-20)21-12-16-23(17-13-21)15-11-19-7-3-1-4-8-19/h1-10,21,25H,11-18H2

Standard InChI Key:  BXGSQUNMZMHPKS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    1.4018  -14.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4007  -15.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1129  -15.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8225  -15.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8197  -14.6274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1111  -14.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5300  -14.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5269  -13.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2372  -12.9794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9457  -13.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6539  -12.9804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6550  -12.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9418  -11.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2275  -12.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3669  -11.7460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0787  -12.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3669  -10.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0787  -10.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6551  -10.5120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0788   -9.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0754  -12.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7823  -13.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4951  -12.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4925  -12.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7809  -11.7425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7865   -9.2821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
 16 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 16  1  0
 20 26  1  0
M  END

Associated Targets(non-human)

SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oprm1 Mu opioid receptor (6060 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 352.48Molecular Weight (Monoisotopic): 352.2151AlogP: 3.11#Rotatable Bonds: 7
Polar Surface Area: 43.78Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.77CX LogP: 2.53CX LogD: 1.15
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.83Np Likeness Score: -0.93

References

1. Lipiński PFJ, Szűcs E, Jarończyk M, Kosson P, Benyhe S, Misicka A, Dobrowolski JC, Sadlej J..  (2019)  Affinity of fentanyl and its derivatives for the σ1-receptor.,  10  (7): [PMID:31391893] [10.1039/C9MD00222G]

Source