Pestalone C

ID: ALA4527030

PubChem CID: 155544113

Max Phase: Preclinical

Molecular Formula: C20H19BrO6

Molecular Weight: 435.27

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CCc1c(O)cc(O)c(C=O)c1C(=O)c1c(O)cc(C)c(Br)c1O

Standard InChI:  InChI=1S/C20H19BrO6/c1-9(2)4-5-11-13(23)7-14(24)12(8-22)16(11)19(26)17-15(25)6-10(3)18(21)20(17)27/h4,6-8,23-25,27H,5H2,1-3H3

Standard InChI Key:  XQQMKKZSDZTYML-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
    5.5827   -6.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5816   -6.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2772   -7.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9745   -6.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9717   -6.0716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2755   -5.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6613   -5.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3582   -6.0663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6664   -7.2770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8901   -7.2781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8914   -5.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8912   -4.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1958   -4.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1956   -3.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5047   -4.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2730   -4.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9671   -4.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5765   -4.0217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6574   -4.4181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3510   -4.0163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3490   -3.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6475   -2.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9610   -3.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6581   -5.2188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0433   -4.4149    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    9.0385   -2.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2627   -2.8256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  4  9  1  0
  2 10  1  0
  1 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 13 15  1  0
  6 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 19 24  1  0
 20 25  1  0
 21 26  1  0
 23 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4527030

    ---

Associated Targets(Human)

MAP2K2 Tclin Dual specificity mitogen-activated protein kinase kinase; MEK1/2 (426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PANC-1 (6144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.27Molecular Weight (Monoisotopic): 434.0365AlogP: 4.13#Rotatable Bonds: 5
Polar Surface Area: 115.06Molecular Species: ACIDHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 5.94CX Basic pKa: CX LogP: 6.89CX LogD: 4.63
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.32Np Likeness Score: 1.69

References

1. Wang W, Park C, Oh E, Sung Y, Lee J, Park KH, Kang H..  (2019)  Benzophenone Compounds, from a Marine-Derived Strain of the Fungus Pestalotiopsis neglecta, Inhibit Proliferation of Pancreatic Cancer Cells by Targeting the MEK/ERK Pathway.,  82  (12): [PMID:31829592] [10.1021/acs.jnatprod.9b00646]

Source