5-(4-(Benzofuran-2-yl)-1H-1,2,3-triazol-1-yl)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic Acid

ID: ALA4527062

PubChem CID: 135356969

Max Phase: Preclinical

Molecular Formula: C28H24N4O3

Molecular Weight: 464.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3cc4ccccc4o3)nn2)c1

Standard InChI:  InChI=1S/C28H24N4O3/c33-28(34)23-13-22(19-7-5-18(6-8-19)20-9-11-29-12-10-20)14-24(15-23)32-17-25(30-31-32)27-16-21-3-1-2-4-26(21)35-27/h1-8,13-17,20,29H,9-12H2,(H,33,34)

Standard InChI Key:  IAZANJJWHUVYOT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   26.6329   -3.9099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4484   -3.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8553   -3.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4479   -2.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6294   -2.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2261   -3.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6687   -3.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0765   -3.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8929   -3.9142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3025   -3.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8897   -2.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0746   -2.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1180   -3.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5261   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3397   -3.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7514   -3.2069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3432   -2.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5235   -2.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2181   -1.7971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6240   -1.0879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4009   -1.8002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2251   -4.6215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4124   -4.7071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2427   -5.5065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9505   -5.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5576   -5.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0347   -6.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4302   -7.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7407   -7.1343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5706   -7.9307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7619   -8.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4313   -8.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9081   -9.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7194   -9.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0464   -8.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
  1 22  1  0
 25 27  1  0
 27 28  2  0
 28 31  1  0
 30 29  1  0
 29 27  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4527062

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.53Molecular Weight (Monoisotopic): 464.1848AlogP: 5.51#Rotatable Bonds: 5
Polar Surface Area: 93.18Molecular Species: ZWITTERIONHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.85CX Basic pKa: 10.07CX LogP: 2.73CX LogD: 2.73
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -0.70

References

1. Junker A, Balasubramanian R, Ciancetta A, Uliassi E, Kiselev E, Martiriggiano C, Trujillo K, Mtchedlidze G, Birdwell L, Brown KA, Harden TK, Jacobson KA..  (2016)  Structure-Based Design of 3-(4-Aryl-1H-1,2,3-triazol-1-yl)-Biphenyl Derivatives as P2Y14 Receptor Antagonists.,  59  (13): [PMID:27331270] [10.1021/acs.jmedchem.6b00044]

Source