The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6-((4-tert-Butylbenzyl)(pyridine-3-sulfonyl)aminomethyl)-1H-indol-1-yl)acetic Acid Trifluoroacetate ID: ALA4527224
PubChem CID: 155544327
Max Phase: Preclinical
Molecular Formula: C29H30F3N3O6S
Molecular Weight: 491.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1ccc(CN(Cc2ccc3ccn(CC(=O)O)c3c2)S(=O)(=O)c2cccnc2)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C27H29N3O4S.C2HF3O2/c1-27(2,3)23-10-7-20(8-11-23)17-30(35(33,34)24-5-4-13-28-16-24)18-21-6-9-22-12-14-29(19-26(31)32)25(22)15-21;3-2(4,5)1(6)7/h4-16H,17-19H2,1-3H3,(H,31,32);(H,6,7)
Standard InChI Key: SKGINFCXLCGSIF-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
28.2440 -12.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9625 -11.7951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6812 -12.2075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9625 -10.9660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5253 -11.7951 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.2440 -13.0366 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.5232 -12.6200 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.3609 -14.5740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5359 -14.5740 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.9484 -15.2885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3971 -14.9948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3960 -15.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1107 -16.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8272 -15.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8243 -14.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1089 -14.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5340 -13.7511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2469 -13.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8181 -13.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8150 -12.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9628 -13.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5297 -12.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0952 -11.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1014 -12.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9612 -14.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6764 -14.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3902 -14.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3844 -13.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6687 -13.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1067 -14.9743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1109 -15.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8190 -14.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8190 -15.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8083 -10.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5238 -11.2766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1373 -10.7235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8008 -9.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9795 -10.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8484 -11.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5622 -10.7191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2772 -11.1304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5610 -9.8941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
9 8 2 0
10 9 2 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
15 9 1 0
9 17 1 0
17 18 1 0
17 19 1 0
19 20 1 0
18 21 1 0
20 22 2 0
22 35 1 0
34 23 1 0
23 24 2 0
24 20 1 0
21 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 21 1 0
27 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
34 35 2 0
35 36 1 0
36 37 1 0
37 38 2 0
38 34 1 0
36 39 1 0
39 40 1 0
40 41 1 0
40 42 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.61Molecular Weight (Monoisotopic): 491.1879AlogP: 4.81#Rotatable Bonds: 8Polar Surface Area: 92.50Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.58CX Basic pKa: 1.08CX LogP: 4.60CX LogD: 1.25Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.64
References 1. Iwamura R, Tanaka M, Okanari E, Kirihara T, Odani-Kawabata N, Shams N, Yoneda K.. (2018) Identification of a Selective, Non-Prostanoid EP2 Receptor Agonist for the Treatment of Glaucoma: Omidenepag and its Prodrug Omidenepag Isopropyl., 61 (15): [PMID:29995405 ] [10.1021/acs.jmedchem.8b00808 ]