Benwamycin A

ID: ALA4527291

PubChem CID: 155544317

Max Phase: Preclinical

Molecular Formula: C17H26O4

Molecular Weight: 294.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]([C@H](O)[C@@H](C)c1ccc(CO)cc1/C=C/CO)[C@H](C)O

Standard InChI:  InChI=1S/C17H26O4/c1-11(13(3)20)17(21)12(2)16-7-6-14(10-19)9-15(16)5-4-8-18/h4-7,9,11-13,17-21H,8,10H2,1-3H3/b5-4+/t11-,12+,13+,17+/m1/s1

Standard InChI Key:  RRVPMUKITYMNPS-DRNLFNEDSA-N

Molfile:  

 
     RDKit          2D

 21 21  0  0  0  0  0  0  0  0999 V2000
    5.2856   -5.4526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9936   -5.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7019   -5.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7019   -6.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9961   -6.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2856   -6.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4100   -6.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1180   -6.2715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9936   -4.2259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7058   -3.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7058   -2.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4139   -2.5870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5775   -5.0450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8694   -5.4526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8694   -6.2721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1572   -5.0450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4492   -5.4526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7411   -5.0450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4492   -6.2721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1572   -4.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5775   -4.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  2  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
  1 13  1  0
 13 14  1  0
 14 15  1  1
 14 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  1
 16 20  1  1
 13 21  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4527291

    ---

Associated Targets(non-human)

3T3-L1 (3664 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 294.39Molecular Weight (Monoisotopic): 294.1831AlogP: 1.67#Rotatable Bonds: 7
Polar Surface Area: 80.92Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.26CX LogD: 1.26
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.62Np Likeness Score: 1.16

References

1. Yang FX, Huang JP, Liu Z, Wang Z, Yang J, Tang J, Yu Z, Yan Y, Kai G, Huang SX..  (2020)  Benwamycins A-G, Trialkyl-Substituted Benzene Derivatives from a Soil-Derived Streptomyces.,  83  (1): [PMID:31904958] [10.1021/acs.jnatprod.9b00903]

Source