The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,2'-(4,4'-thiobis(4,1-phenylene))bis(N-isopropyl-1H-benzo[d]imidazole-5-carboximidamide) ID: ALA452731
PubChem CID: 136117835
Max Phase: Preclinical
Molecular Formula: C34H34N8S
Molecular Weight: 586.77
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)NC(=N)c1ccc2[nH]c(-c3ccc(Sc4ccc(-c5nc6cc(C(=N)NC(C)C)ccc6[nH]5)cc4)cc3)nc2c1
Standard InChI: InChI=1S/C34H34N8S/c1-19(2)37-31(35)23-9-15-27-29(17-23)41-33(39-27)21-5-11-25(12-6-21)43-26-13-7-22(8-14-26)34-40-28-16-10-24(18-30(28)42-34)32(36)38-20(3)4/h5-20H,1-4H3,(H2,35,37)(H2,36,38)(H,39,41)(H,40,42)
Standard InChI Key: IEWATRKWOXRHDO-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
7.5529 -8.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8396 -9.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1261 -8.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5527 -8.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8437 -7.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1250 -8.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8396 -6.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6676 -6.8169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2686 -9.2791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9857 -10.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9857 -11.3568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7017 -10.1196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4271 -6.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6040 -6.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1903 -5.3078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6009 -4.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4285 -4.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8408 -5.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8184 -3.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8201 -4.2927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1038 -4.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1065 -3.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3894 -3.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3890 -4.2928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8902 -3.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3996 -3.2027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5300 -3.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9596 -3.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6712 -3.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9596 -2.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7151 -3.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1269 -4.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9506 -4.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3640 -3.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9444 -3.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1228 -3.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1889 -3.8749 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.5169 -7.4882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9983 -8.8618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2805 -10.1040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3988 -4.5377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5168 -2.2226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2448 -3.4637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
7 8 2 0
8 5 1 0
1 9 1 0
10 11 1 0
10 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
7 13 1 0
19 20 2 0
20 21 1 0
21 24 2 0
23 22 2 0
22 19 1 0
23 24 1 0
25 26 2 0
26 23 1 0
19 27 1 0
28 29 1 0
28 30 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
25 31 1 0
34 37 1 0
37 16 1 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
9 40 1 0
40 10 1 0
24 41 1 0
41 25 1 0
9 39 2 0
27 42 2 0
6 38 1 0
38 7 1 0
27 43 1 0
43 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.77Molecular Weight (Monoisotopic): 586.2627AlogP: 7.57#Rotatable Bonds: 8Polar Surface Area: 129.12Molecular Species: BASEHBA: 5HBD: 6#RO5 Violations: 3HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.19CX Basic pKa: 10.66CX LogP: 6.22CX LogD: 2.06Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.08Np Likeness Score: -0.64
References 1. Hu L, Kully ML, Boykin DW, Abood N.. (2009) Optimization of the central linker of dicationic bis-benzimidazole anti-MRSA and anti-VRE agents., 19 (13): [PMID:19481935 ] [10.1016/j.bmcl.2009.05.061 ]